2-BROMO-1-(4'-BROMO-[1,1'-BIPHENYL]-4-YL)ETHANONE structure
|
Common Name | 2-BROMO-1-(4'-BROMO-[1,1'-BIPHENYL]-4-YL)ETHANONE | ||
|---|---|---|---|---|
| CAS Number | 94512-73-9 | Molecular Weight | 354.03700 | |
| Density | 1.642g/cm3 | Boiling Point | 413.5ºC at 760mmHg | |
| Molecular Formula | C14H10Br2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 118.6ºC | |
| Name | 2-bromo-1-[4-(4-bromophenyl)phenyl]ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.642g/cm3 |
|---|---|
| Boiling Point | 413.5ºC at 760mmHg |
| Molecular Formula | C14H10Br2O |
| Molecular Weight | 354.03700 |
| Flash Point | 118.6ºC |
| Exact Mass | 351.91000 |
| PSA | 17.07000 |
| LogP | 4.69370 |
| Index of Refraction | 1.625 |
| InChIKey | MHUAWTIXPZEHRL-UHFFFAOYSA-N |
| SMILES | O=C(CBr)c1ccc(-c2ccc(Br)cc2)cc1 |
|
~91%
2-BROMO-1-(4'-B... CAS#:94512-73-9 |
| Literature: VERTEX PHARMACEUTICALS INCORPORATED; DAS, Sanjoy Kumar; BENNANI, Youssef L. Patent: WO2011/119853 A1, 2011 ; Location in patent: Page/Page column 95 ; |
|
~%
2-BROMO-1-(4'-B... CAS#:94512-73-9 |
| Literature: Schwab, John M.; Lin, Daniel C. T. Journal of the American Chemical Society, 1985 , vol. 107, # 21 p. 6046 - 6052 |
|
~67%
2-BROMO-1-(4'-B... CAS#:94512-73-9 |
| Literature: Roman, Gheorghe; Vlahakis, Jason Z.; Vukomanovic, Dragic; Nakatsu, Kanji; Szarek, Walter A. ChemMedChem, 2010 , vol. 5, # 9 p. 1541 - 1555 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-bromo-1-(4'-bromo-biphenyl-4-yl)-ethanone |
| 2-Bromo-1-(4''-Bromo-1,1''-Biphenyl-4-Yl)Ethanone |
| 1-(2-bromoethanone)-4-(4-bromophenyl)-benzene |
| 4-(4'-bromophenyl)bromoacetophenone |