2-benzyldisulfanylbutanedioic acid structure
|
Common Name | 2-benzyldisulfanylbutanedioic acid | ||
|---|---|---|---|---|
| CAS Number | 94520-49-7 | Molecular Weight | 272.34100 | |
| Density | 1.438g/cm3 | Boiling Point | 415.1ºC at 760 mmHg | |
| Molecular Formula | C11H12O4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 204.9ºC | |
| Name | 2-(benzyldisulfanyl)butanedioic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.438g/cm3 |
|---|---|
| Boiling Point | 415.1ºC at 760 mmHg |
| Molecular Formula | C11H12O4S2 |
| Molecular Weight | 272.34100 |
| Flash Point | 204.9ºC |
| Exact Mass | 272.01800 |
| PSA | 125.20000 |
| LogP | 2.49590 |
| Index of Refraction | 1.646 |
| InChIKey | ULHKCUJOONCJHB-UHFFFAOYSA-N |
| SMILES | O=C(O)CC(SSCc1ccccc1)C(=O)O |
|
~%
2-benzyldisulfa... CAS#:94520-49-7 |
| Literature: Hiskey,R.G.; Tucker,W.P. Journal of the American Chemical Society, 1962 , vol. 84, p. 4789 - 4794 |
|
~%
2-benzyldisulfa... CAS#:94520-49-7 |
| Literature: Hiskey,R.G. et al. Journal of Organic Chemistry, 1961 , vol. 26, p. 1152 - 1155 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 3-Carboxy-6-phenyl-4,5-dithia-hexansaeure |
| 5-Phenyl-3,4-dithiapentan-dicarbonsaeure-1,2 |