4,4'-[1,4-Phenylenebis(oxy)]bis[3-(trifluoromethyl)aniline] structure
|
Common Name | 4,4'-[1,4-Phenylenebis(oxy)]bis[3-(trifluoromethyl)aniline] | ||
|---|---|---|---|---|
| CAS Number | 94525-05-0 | Molecular Weight | 428.32800 | |
| Density | 1.417g/cm3 | Boiling Point | 465.748ºC at 760 mmHg | |
| Molecular Formula | C20H14F6N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 235.476ºC | |
| Name | 4-[4-[4-amino-2-(trifluoromethyl)phenoxy]phenoxy]-3-(trifluoromethyl)aniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.417g/cm3 |
|---|---|
| Boiling Point | 465.748ºC at 760 mmHg |
| Molecular Formula | C20H14F6N2O2 |
| Molecular Weight | 428.32800 |
| Flash Point | 235.476ºC |
| Exact Mass | 428.09600 |
| PSA | 70.50000 |
| LogP | 7.63560 |
| Index of Refraction | 1.559 |
| InChIKey | LACZRKUWKHQVKS-UHFFFAOYSA-N |
| SMILES | Nc1ccc(Oc2ccc(Oc3ccc(N)cc3C(F)(F)F)cc2)c(C(F)(F)F)c1 |
| HS Code | 2922299090 |
|---|
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 1,4-bis(4-aMino-2-trifluoroMethylphenoxy)benzene |
| 4,4'-(1,4-Phenylenebis(oxy))bis(3-(trifluoromethyl)aniline) |
| 4,4'-[1,4-Phenylenebis(oxy)]bis[3-(trifluoromethyl]benzenamine |