6-[[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)amino]methylidene]cyclohexa-2,4-dien-1-one structure
|
Common Name | 6-[[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)amino]methylidene]cyclohexa-2,4-dien-1-one | ||
|---|---|---|---|---|
| CAS Number | 94527-22-7 | Molecular Weight | 237.30100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H7N3OS2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-[[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)amino]methylidene]cyclohexa-2,4-dien-1-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H7N3OS2 |
|---|---|
| Molecular Weight | 237.30100 |
| Exact Mass | 237.00300 |
| PSA | 121.92000 |
| LogP | 1.89070 |
| InChIKey | IALAVJLXFRTJRB-UHFFFAOYSA-N |
| SMILES | Oc1ccccc1C=Nc1n[nH]c(=S)s1 |
|
~86%
6-[[(2-sulfanyl... CAS#:94527-22-7 |
| Literature: Mobinikhaledi; Jabbarpour; Hamta Journal of the Chilean Chemical Society, 2011 , vol. 56, # 3 p. 812 - 814 |
| 1,3,4-Thiadiazole-2(3H)-thione,5-[[(2-hydroxyphenyl)methylene]amino] |
| 2-salicylideneimino-5-mercapto-1,3,4-thiadiazole |
| 2-(2-hydroxybenzylideneamino)-5-mercapto-1,3,4-thiadiazole |