Senkyunolide G structure
|
Common Name | Senkyunolide G | ||
|---|---|---|---|---|
| CAS Number | 94530-85-5 | Molecular Weight | 208.254 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 424.9±40.0 °C at 760 mmHg | |
| Molecular Formula | C12H16O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 189.0±20.1 °C | |
Use of Senkyunolide GSenkyunolide G (3-Hydroxysenkyunolide A) is a natural product that can be isolated from Angelica sinensis[1]. |
| Name | (S)-3-butyl-3-hydroxy-4,5-dihydroisobenzofuran-1(3H)-one |
|---|---|
| Synonym | More Synonyms |
| Description | Senkyunolide G (3-Hydroxysenkyunolide A) is a natural product that can be isolated from Angelica sinensis[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 424.9±40.0 °C at 760 mmHg |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 208.254 |
| Flash Point | 189.0±20.1 °C |
| Exact Mass | 208.109940 |
| PSA | 46.53000 |
| LogP | 1.30 |
| Vapour Pressure | 0.0±2.3 mmHg at 25°C |
| Index of Refraction | 1.549 |
| InChIKey | JGIFAEPLZJPSHA-UHFFFAOYSA-N |
| SMILES | CCCCC1(O)OC(=O)C2=C1CCC=C2 |
| HS Code | 2932209090 |
|---|
| HS Code | 2932209090 |
|---|---|
| Summary | 2932209090. other lactones. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| (3S)-3-Butyl-3-hydroxy-4,5-dihydro-2-benzofuran-1(3H)-one |
| 1(3H)-Isobenzofuranone, 3-butyl-4,5-dihydro-3-hydroxy-, (3S)- |