6-(3-methoxybutylidene)-1,5,5-trimethylcyclohexene structure
|
Common Name | 6-(3-methoxybutylidene)-1,5,5-trimethylcyclohexene | ||
|---|---|---|---|---|
| CAS Number | 945426-65-3 | Molecular Weight | 207.33200 | |
| Density | 0.907g/cm3 | Boiling Point | 261.7ºC at 760 mmHg | |
| Molecular Formula | C14H23O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 98.8ºC | |
| Name | 6-(3-methoxybutylidene)-1,5,5-trimethylcyclohexene |
|---|---|
| Synonym | More Synonyms |
| Density | 0.907g/cm3 |
|---|---|
| Boiling Point | 261.7ºC at 760 mmHg |
| Molecular Formula | C14H23O |
| Molecular Weight | 207.33200 |
| Flash Point | 98.8ºC |
| Exact Mass | 207.17500 |
| LogP | 4.13580 |
| Index of Refraction | 1.502 |
| InChIKey | UJJLMWKISWEECA-UKTHLTGXSA-N |
| SMILES | COC(C)CC=C1C(C)=CCCC1(C)C |
| HS Code | 2909209000 |
|---|
|
~97%
6-(3-methoxybut... CAS#:945426-65-3 |
| Literature: Campagnole; Delmond, Bernard Synthetic Communications, 2007 , vol. 37, # 7 p. 1077 - 1090 |
|
~%
6-(3-methoxybut... CAS#:945426-65-3 |
| Literature: Campagnole; Delmond, Bernard Synthetic Communications, 2007 , vol. 37, # 7 p. 1077 - 1090 |
| HS Code | 2909209000 |
|---|---|
| Summary | 2909209000 other cyclanic, cyclenic or cyclotherpenic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 4-(2,6,6-trimethyl-2-cyclohexen-1-ylidene)-2-methoxybutane |
| (6Z)-6-(3-Methoxybutylidene)-1,5,5-trimethylcyclohexene |