Benzenesulfonic acid,4-bromo-, 5-methyl-2-propylphenyl ester structure
|
Common Name | Benzenesulfonic acid,4-bromo-, 5-methyl-2-propylphenyl ester | ||
|---|---|---|---|---|
| CAS Number | 94572-11-9 | Molecular Weight | 369.27300 | |
| Density | 1.394g/cm3 | Boiling Point | 468ºC at 760mmHg | |
| Molecular Formula | C16H17BrO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 236.8ºC | |
| Name | (5-methyl-2-propylphenyl) 4-bromobenzenesulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.394g/cm3 |
|---|---|
| Boiling Point | 468ºC at 760mmHg |
| Molecular Formula | C16H17BrO3S |
| Molecular Weight | 369.27300 |
| Flash Point | 236.8ºC |
| Exact Mass | 368.00800 |
| PSA | 51.75000 |
| LogP | 5.55850 |
| Index of Refraction | 1.58 |
| InChIKey | NXQIUPWTSLIRBQ-UHFFFAOYSA-N |
| SMILES | CCCc1ccc(C)cc1OS(=O)(=O)c1ccc(Br)cc1 |
|
~%
Benzenesulfonic... CAS#:94572-11-9 |
| Literature: White,W.N.; Slater,C.D. Journal of Organic Chemistry, 1961 , vol. 26, p. 3631 - 3638 |
|
~%
Benzenesulfonic... CAS#:94572-11-9 |
| Literature: White,W.N.; Slater,C.D. Journal of Organic Chemistry, 1961 , vol. 26, p. 3631 - 3638 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| <5-Methyl-2-propyl-phenyl>-4-brom-benzolsulfonat |
| 5-methyl-2-propylphenyl 4-bromobenzenesulfonate |