6-acetyl-1,3,7-trimethyl-pteridine-2,4-dione
Modify Date: 2026-09-25 18:25:30
6-acetyl-1,3,7-trimethyl-pteridine-2,4-dione structure
|
Common Name | 6-acetyl-1,3,7-trimethyl-pteridine-2,4-dione | ||
|---|---|---|---|---|
| CAS Number | 94591-19-2 | Molecular Weight | 248.24 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H12N4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 6-acetyl-1,3,7-trimethyl-pteridine-2,4-dione |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H12N4O3 |
|---|---|
| Molecular Weight | 248.24 |
| InChIKey | QIICXDUQNHXBDB-UHFFFAOYSA-N |
| SMILES | CC(=O)c1nc2c(=O)n(C)c(=O)n(C)c2nc1C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 6-acetyl-1,3,7-trimethyl-pteridine-2,4-dione? |
| A: SMILES notation of 6-acetyl-1,3,7-trimethyl-pteridine-2,4-dione is CC(=O)c1nc2c(=O)n(C)c(=O)n(C)c2nc1C. |
| Q: What is the Chinese name of 94591-19-2? |
| A: Chinese name of 94591-19-2 is 94591-19-2. |
| Q: What is the CAS number of 6-acetyl-1,3,7-trimethyl-pteridine-2,4-dione? |
| A: CAS number of 6-acetyl-1,3,7-trimethyl-pteridine-2,4-dione is 94591-19-2. |
| Q: What is the molecular weight of 6-acetyl-1,3,7-trimethyl-pteridine-2,4-dione? |
| A: Molecular weight of 6-acetyl-1,3,7-trimethyl-pteridine-2,4-dione is 248.24. |
| Q: What is the English name of 6-acetyl-1,3,7-trimethyl-pteridine-2,4-dione? |
| A: The English name of 6-acetyl-1,3,7-trimethyl-pteridine-2,4-dione is 6-acetyl-1,3,7-trimethyl-pteridine-2,4-dione. |
| Q: What is the InChIKey of 6-acetyl-1,3,7-trimethyl-pteridine-2,4-dione? |
| A: InChIKey of 6-acetyl-1,3,7-trimethyl-pteridine-2,4-dione is QIICXDUQNHXBDB-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 6-acetyl-1,3,7-trimethyl-pteridine-2,4-dione? |
| A: Molecular formula of 6-acetyl-1,3,7-trimethyl-pteridine-2,4-dione is C11H12N4O3. |