Senkyunolide H structure
|
Common Name | Senkyunolide H | ||
|---|---|---|---|---|
| CAS Number | 94596-27-7 | Molecular Weight | 224.253 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 444.8±45.0 °C at 760 mmHg | |
| Molecular Formula | C12H16O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 175.1±22.2 °C | |
Use of Senkyunolide HSenkyunolide H is a natural compound isolated from Ligusticum chuanxiong Hort[1]. |
| Name | Dimethyl 3-oxo-3H-pyrrolo[2,1,5-de]quinolizine-1,2-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Description | Senkyunolide H is a natural compound isolated from Ligusticum chuanxiong Hort[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 444.8±45.0 °C at 760 mmHg |
| Molecular Formula | C12H16O4 |
| Molecular Weight | 224.253 |
| Flash Point | 175.1±22.2 °C |
| Exact Mass | 224.104858 |
| PSA | 66.76000 |
| LogP | 1.04 |
| Vapour Pressure | 0.0±2.4 mmHg at 25°C |
| Index of Refraction | 1.571 |
| InChIKey | DQNGMIQSXNGHOA-OBEBJBLMSA-N |
| SMILES | CCCC=C1OC(=O)C2=C1CCC(O)C2O |
| Storage condition | 2-8℃ |
| Hazard Codes | Xi |
|---|
| (3Z)-3-Butylidene-6,7-dihydroxy-4,5,6,7-tetrahydro-2-benzofuran-1(3H)-one |
| (3Z,6S,7R)-3-Butylidene-6,7-dihydroxy-4,5,6,7-tetrahydro-2-benzofuran-1(3H)-one |
| Seneciphyllin |
| 1(3H)-Isobenzofuranone, 3-butylidene-4,5,6,7-tetrahydro-6,7-dihydroxy-, (3Z,6S,7R)- |
| Senkyunolide H |
| 1(3H)-Isobenzofuranone, 3-butylidene-4,5,6,7-tetrahydro-6,7-dihydroxy-, (3Z)- |
| 3-butylidene-4,5,6,7-tetrahydro-6,7-dihydroxy-1(3H)-isobenzofuranone |