Benzoic acid, 2-formyl-6-methoxy-3-methyl
Modify Date: 2026-07-08 18:49:36
Benzoic acid, 2-formyl-6-methoxy-3-methyl structure
|
Common Name | Benzoic acid, 2-formyl-6-methoxy-3-methyl | ||
|---|---|---|---|---|
| CAS Number | 945981-91-9 | Molecular Weight | 194.18 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H10O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Benzoic acid, 2-formyl-6-methoxy-3-methyl |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H10O4 |
|---|---|
| Molecular Weight | 194.18 |
| InChIKey | UYCOQDLLWRWIMV-UHFFFAOYSA-N |
| SMILES | COc1ccc(C)c(C=O)c1C(=O)O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of Benzoic acid, 2-formyl-6-methoxy-3-methyl? |
| A: Molecular formula of Benzoic acid, 2-formyl-6-methoxy-3-methyl is C10H10O4. |
| Q: What is the molecular weight of Benzoic acid, 2-formyl-6-methoxy-3-methyl? |
| A: Molecular weight of Benzoic acid, 2-formyl-6-methoxy-3-methyl is 194.18. |
| Q: What is the SMILES notation of Benzoic acid, 2-formyl-6-methoxy-3-methyl? |
| A: SMILES notation of Benzoic acid, 2-formyl-6-methoxy-3-methyl is COc1ccc(C)c(C=O)c1C(=O)O. |
| Q: What is the Chinese name of 945981-91-9? |
| A: Chinese name of 945981-91-9 is 945981-91-9. |
| Q: What is the English name of Benzoic acid, 2-formyl-6-methoxy-3-methyl? |
| A: The English name of Benzoic acid, 2-formyl-6-methoxy-3-methyl is Benzoic acid, 2-formyl-6-methoxy-3-methyl. |
| Q: What is the CAS number of Benzoic acid, 2-formyl-6-methoxy-3-methyl? |
| A: CAS number of Benzoic acid, 2-formyl-6-methoxy-3-methyl is 945981-91-9. |
| Q: What is the InChIKey of Benzoic acid, 2-formyl-6-methoxy-3-methyl? |
| A: InChIKey of Benzoic acid, 2-formyl-6-methoxy-3-methyl is UYCOQDLLWRWIMV-UHFFFAOYSA-N. |