Ethyl 5-chloro-4-formyl-1-methyl-1H-pyrazole-3-carboxylate structure
|
Common Name | Ethyl 5-chloro-4-formyl-1-methyl-1H-pyrazole-3-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 946061-21-8 | Molecular Weight | 216.62200 | |
| Density | 1.37 | Boiling Point | 356.1ºC at 760 mmHg | |
| Molecular Formula | C8H9ClN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 169.1ºC | |
| Name | ethyl 5-chloro-4-formyl-1-methylpyrazole-3-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.37 |
|---|---|
| Boiling Point | 356.1ºC at 760 mmHg |
| Molecular Formula | C8H9ClN2O3 |
| Molecular Weight | 216.62200 |
| Flash Point | 169.1ºC |
| Exact Mass | 216.03000 |
| PSA | 61.19000 |
| LogP | 1.06270 |
| Index of Refraction | 1.565 |
| InChIKey | QEPOBLYUNYIKSX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1nn(C)c(Cl)c1C=O |
| HS Code | 2933199090 |
|---|
|
~%
Ethyl 5-chloro-... CAS#:946061-21-8 |
| Literature: EP1988081 A1, ; Page/Page column 40 ; EP 1988081 A1 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-Chloro-4-formyl-1-methyl-1H-pyrazole-3-carboxylic acid ethyl ester |
| ethyl 5-chloro-4-formyl-1-methyl-1H-pyrazole-3-carboxylate |