4-((2,5-Dimethoxyphenyl)sulfonyl)-2-phenylmorpholine
Modify Date: 2025-09-23 00:29:23
4-((2,5-Dimethoxyphenyl)sulfonyl)-2-phenylmorpholine structure
|
Common Name | 4-((2,5-Dimethoxyphenyl)sulfonyl)-2-phenylmorpholine | ||
|---|---|---|---|---|
| CAS Number | 946292-02-0 | Molecular Weight | 363.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H21NO5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-((2,5-Dimethoxyphenyl)sulfonyl)-2-phenylmorpholine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C18H21NO5S |
|---|---|
| Molecular Weight | 363.4 |
| InChIKey | GTJQUOBZNZKQKG-UHFFFAOYSA-N |
| SMILES | COc1ccc(OC)c(S(=O)(=O)N2CCOC(c3ccccc3)C2)c1 |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: USP8 deubiquitinase inhibition: Primary qHTS
Source: 24642
Target: ubiquitin specific peptidase 8
External Id: USP8 FAST DUB HTS Primary
|
|
Name: USP17 deubiquitinase inhibition: Primary qHTS
Source: 24642
Target: ubiquitin specific peptidase 17 like family member 5
External Id: USP17 FAST DUB HTS Primary
|
|
Name: USP7 deubiquitinase inhibition: Primary qHTS
Source: 24642
Target: ubiquitin specific peptidase 7
External Id: USP7 FAST DUB HTS Primary
|
|
Name: USP28 deubiquitinase inhibition: Primary qHTS
Source: 24642
Target: ubiquitin specific peptidase 28
External Id: USP28 FAST DUB HTS Primary
|
|
Name: USP10 deubiquitinase inhibition: Primary qHTS
Source: 24642
Target: ubiquitin specific peptidase 10
External Id: USP10 FAST DUB HTS Primary
|
|
Name: UCHL1 deubiquitinase inhibition: Primary qHTS
Source: 24642
Target: ubiquitin C-terminal hydrolase L1
External Id: UCHL1 FAST DUB HTS Primary
|
|
Name: OTUD3 deubiquitinase inhibition: Primary qHTS
Source: 24642
Target: OTU deubiquitinase 3
External Id: OTUD3 FAST DUB HTS Primary
|
|
Name: USP30 deubiquitinase inhibition: Primary qHTS
Source: 24642
Target: ubiquitin specific peptidase 30
External Id: USP30 FAST DUB HTS Primary
|
Total 8, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 946292-02-0? |
| A: Chinese name of 946292-02-0 is 946292-02-0. |
| Q: What is the molecular formula of 4-((2,5-Dimethoxyphenyl)sulfonyl)-2-phenylmorpholine? |
| A: Molecular formula of 4-((2,5-Dimethoxyphenyl)sulfonyl)-2-phenylmorpholine is C18H21NO5S. |
| Q: What is the InChIKey of 4-((2,5-Dimethoxyphenyl)sulfonyl)-2-phenylmorpholine? |
| A: InChIKey of 4-((2,5-Dimethoxyphenyl)sulfonyl)-2-phenylmorpholine is GTJQUOBZNZKQKG-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 4-((2,5-Dimethoxyphenyl)sulfonyl)-2-phenylmorpholine? |
| A: Molecular weight of 4-((2,5-Dimethoxyphenyl)sulfonyl)-2-phenylmorpholine is 363.4. |
| Q: What is the SMILES notation of 4-((2,5-Dimethoxyphenyl)sulfonyl)-2-phenylmorpholine? |
| A: SMILES notation of 4-((2,5-Dimethoxyphenyl)sulfonyl)-2-phenylmorpholine is COc1ccc(OC)c(S(=O)(=O)N2CCOC(c3ccccc3)C2)c1. |
| Q: What is the CAS number of 4-((2,5-Dimethoxyphenyl)sulfonyl)-2-phenylmorpholine? |
| A: CAS number of 4-((2,5-Dimethoxyphenyl)sulfonyl)-2-phenylmorpholine is 946292-02-0. |
| Q: What is the English name of 4-((2,5-Dimethoxyphenyl)sulfonyl)-2-phenylmorpholine? |
| A: The English name of 4-((2,5-Dimethoxyphenyl)sulfonyl)-2-phenylmorpholine is 4-((2,5-Dimethoxyphenyl)sulfonyl)-2-phenylmorpholine. |