CHEMBRDG-BB 4000321 structure
|
Common Name | CHEMBRDG-BB 4000321 | ||
|---|---|---|---|---|
| CAS Number | 94635-24-2 | Molecular Weight | 205.25300 | |
| Density | 1.126g/cm3 | Boiling Point | 371.9ºC at 760 mmHg | |
| Molecular Formula | C12H15NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 178.7ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-(4-methoxyphenyl)piperidin-4-one |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.126g/cm3 |
|---|---|
| Boiling Point | 371.9ºC at 760 mmHg |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.25300 |
| Flash Point | 178.7ºC |
| Exact Mass | 205.11000 |
| PSA | 29.54000 |
| LogP | 1.92950 |
| Index of Refraction | 1.548 |
| InChIKey | MHCJYEJFOPYGEL-UHFFFAOYSA-N |
| SMILES | COc1ccc(N2CCC(=O)CC2)cc1 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2933399090 |
|---|
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 1-(4-methoxyphenyl)piperidin-4-one? |
| A: InChIKey of 1-(4-methoxyphenyl)piperidin-4-one is MHCJYEJFOPYGEL-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 1-(4-methoxyphenyl)piperidin-4-one? |
| A: Molecular weight of 1-(4-methoxyphenyl)piperidin-4-one is 205.25300. |
| Q: What is the polar surface area (PSA) of 1-(4-methoxyphenyl)piperidin-4-one? |
| A: Polar surface area (PSA) of 1-(4-methoxyphenyl)piperidin-4-one is 29.54000. |
| Q: What is the molecular formula of 1-(4-methoxyphenyl)piperidin-4-one? |
| A: Molecular formula of 1-(4-methoxyphenyl)piperidin-4-one is C12H15NO2. |
| Q: What is the SMILES notation of 1-(4-methoxyphenyl)piperidin-4-one? |
| A: SMILES notation of 1-(4-methoxyphenyl)piperidin-4-one is COc1ccc(N2CCC(=O)CC2)cc1. |
| Q: What is the CAS number of 1-(4-methoxyphenyl)piperidin-4-one? |
| A: CAS number of 1-(4-methoxyphenyl)piperidin-4-one is 94635-24-2. |
| Q: What is the boiling point of 1-(4-methoxyphenyl)piperidin-4-one? |
| A: Boiling point of 1-(4-methoxyphenyl)piperidin-4-one is 371.9ºC at 760 mmHg. |
| Q: What is the LogP of 1-(4-methoxyphenyl)piperidin-4-one? |
| A: LogP of 1-(4-methoxyphenyl)piperidin-4-one is 1.92950. |
| Q: What is the English name of 1-(4-methoxyphenyl)piperidin-4-one? |
| A: The English name of 1-(4-methoxyphenyl)piperidin-4-one is 1-(4-methoxyphenyl)piperidin-4-one. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |