CHEMBRDG-BB 4000321
CHEMBRDG-BB 4000321 structure
|
Common Name | CHEMBRDG-BB 4000321 | ||
|---|---|---|---|---|
| CAS Number | 94635-24-2 | Molecular Weight | 205.25300 | |
| Density | 1.126g/cm3 | Boiling Point | 371.9ºC at 760 mmHg | |
| Molecular Formula | C12H15NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 178.7ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-(4-methoxyphenyl)piperidin-4-one |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.126g/cm3 |
|---|---|
| Boiling Point | 371.9ºC at 760 mmHg |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.25300 |
| Flash Point | 178.7ºC |
| Exact Mass | 205.11000 |
| PSA | 29.54000 |
| LogP | 1.92950 |
| Index of Refraction | 1.548 |
| InChIKey | MHCJYEJFOPYGEL-UHFFFAOYSA-N |
| SMILES | COc1ccc(N2CCC(=O)CC2)cc1 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2933399090 |
|---|
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
![8-(4-methoxyphenyl)-1,4-dioxa-8-azaspiro[4.5]decane structure](https://image.chemsrc.com/caspic/046/634904-81-7.png)
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 1-(4-methoxyphenyl)piperidin-4-one? |
| A: InChIKey of 1-(4-methoxyphenyl)piperidin-4-one is MHCJYEJFOPYGEL-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 1-(4-methoxyphenyl)piperidin-4-one? |
| A: Molecular weight of 1-(4-methoxyphenyl)piperidin-4-one is 205.25300. |
| Q: What is the polar surface area (PSA) of 1-(4-methoxyphenyl)piperidin-4-one? |
| A: Polar surface area (PSA) of 1-(4-methoxyphenyl)piperidin-4-one is 29.54000. |
| Q: What is the molecular formula of 1-(4-methoxyphenyl)piperidin-4-one? |
| A: Molecular formula of 1-(4-methoxyphenyl)piperidin-4-one is C12H15NO2. |
| Q: What is the SMILES notation of 1-(4-methoxyphenyl)piperidin-4-one? |
| A: SMILES notation of 1-(4-methoxyphenyl)piperidin-4-one is COc1ccc(N2CCC(=O)CC2)cc1. |
| Q: What is the CAS number of 1-(4-methoxyphenyl)piperidin-4-one? |
| A: CAS number of 1-(4-methoxyphenyl)piperidin-4-one is 94635-24-2. |
| Q: What is the boiling point of 1-(4-methoxyphenyl)piperidin-4-one? |
| A: Boiling point of 1-(4-methoxyphenyl)piperidin-4-one is 371.9ºC at 760 mmHg. |
| Q: What is the LogP of 1-(4-methoxyphenyl)piperidin-4-one? |
| A: LogP of 1-(4-methoxyphenyl)piperidin-4-one is 1.92950. |
| Q: What is the English name of 1-(4-methoxyphenyl)piperidin-4-one? |
| A: The English name of 1-(4-methoxyphenyl)piperidin-4-one is 1-(4-methoxyphenyl)piperidin-4-one. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |