TG53 structure
|
Common Name | TG53 | ||
|---|---|---|---|---|
| CAS Number | 946369-04-6 | Molecular Weight | 411.88 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C21H22ClN5O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of TG53TG53 is a potent inhibitor of tissue transglutaminase (TG2) and fibronectin (FN) protein-protein interaction. TG53 inhibits formation of a complex with integrin β1 and activation of FAK and c-Src during SKOV3 cell attachment onto FN. TG53 can be used for ovarian cancer research[1]. |
| Name | 5-Chloro-N-(4-{[4-(dimethylamino)-6-methyl-2-pyrimidinyl]amino}phenyl)-2-methoxybenzamide |
|---|---|
| Synonym | More Synonyms |
| Description | TG53 is a potent inhibitor of tissue transglutaminase (TG2) and fibronectin (FN) protein-protein interaction. TG53 inhibits formation of a complex with integrin β1 and activation of FAK and c-Src during SKOV3 cell attachment onto FN. TG53 can be used for ovarian cancer research[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Molecular Formula | C21H22ClN5O2 |
| Molecular Weight | 411.88 |
| Exact Mass | 411.146210 |
| LogP | 3.41 |
| Index of Refraction | 1.677 |
| InChIKey | JHHHSGYKBKIUBG-UHFFFAOYSA-N |
| SMILES | COc1ccc(Cl)cc1C(=O)Nc1ccc(Nc2nc(C)cc(N(C)C)n2)cc1 |
| 5-Chloro-N-(4-{[4-(dimethylamino)-6-methyl-2-pyrimidinyl]amino}phenyl)-2-methoxybenzamide |
| Benzamide, 5-chloro-N-[4-[[4-(dimethylamino)-6-methyl-2-pyrimidinyl]amino]phenyl]-2-methoxy- |