dinaphthalen-1-yl oxalate structure
|
Common Name | dinaphthalen-1-yl oxalate | ||
|---|---|---|---|---|
| CAS Number | 94644-74-3 | Molecular Weight | 342.34400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H14O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | dinaphthalen-1-yl oxalate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C22H14O4 |
|---|---|
| Molecular Weight | 342.34400 |
| Exact Mass | 342.08900 |
| PSA | 52.60000 |
| LogP | 4.50400 |
| InChIKey | FFHXCBMTEIRFEA-UHFFFAOYSA-N |
| SMILES | O=C(Oc1cccc2ccccc12)C(=O)Oc1cccc2ccccc12 |
|
~%
dinaphthalen-1-... CAS#:94644-74-3 |
| Literature: Adams; Gilman Journal of the American Chemical Society, 1915 , vol. 37, p. 2719 |
|
~%
dinaphthalen-1-... CAS#:94644-74-3 |
| Literature: Bischoff; v. Hedenstroem Chemische Berichte, 1902 , vol. 35, p. 3447 |
| Oxalsaeure-di-[1]naphthylester |
| Ethanedioic acid,di-1-naphthalenyl ester |
| di-1-naphthyl oxalate |
| oxalic acid di-[1]naphthyl ester |