Avicine pseudocyanide structure
|
Common Name | Avicine pseudocyanide | ||
|---|---|---|---|---|
| CAS Number | 94656-26-5 | Molecular Weight | 358.34700 | |
| Density | 1.54g/cm3 | Boiling Point | 635.5ºC at 760 mmHg | |
| Molecular Formula | C21H14N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 338.2ºC | |
| Name | Avicine pseudocyanide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.54g/cm3 |
|---|---|
| Boiling Point | 635.5ºC at 760 mmHg |
| Molecular Formula | C21H14N2O4 |
| Molecular Weight | 358.34700 |
| Flash Point | 338.2ºC |
| Exact Mass | 358.09500 |
| PSA | 63.95000 |
| LogP | 4.04368 |
| Index of Refraction | 1.776 |
| InChIKey | LOZDSKFFBIELES-UHFFFAOYSA-N |
| SMILES | CN1c2c(ccc3cc4c(cc23)OCO4)-c2cc3c(cc2C1C#N)OCO3 |
|
~%
Avicine pseudoc... CAS#:94656-26-5 |
| Literature: Arthur et al. Journal of the Chemical Society, 1959 , p. 4007 |
| 5-Methyl-5,6-dihydro-[1,3]dioxolo[4,5-j][1,3]dioxolo[4',5':4,5]benzo[1,2-c]phenanthridin-6-carbonitril |
| 1,3-Benzodioxolo(5,6-c)(1,3)dioxolo(4,5-j)phenanthridine-6-carbonitrile,5,6-dihydro-5-methyl |
| 5-methyl-5,6-dihydro-[1,3]dioxolo[4,5-j][1,3]dioxolo[4',5':4,5]benzo[1,2-c]phenanthridine-6-carbonitrile |