2-[2-hydroxy-3-(4-nitrophenoxy)propyl]isoindole-1,3-dione structure
|
Common Name | 2-[2-hydroxy-3-(4-nitrophenoxy)propyl]isoindole-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 94662-07-4 | Molecular Weight | 342.30300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H14N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-[2-hydroxy-3-(4-nitrophenoxy)propyl]isoindole-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H14N2O6 |
|---|---|
| Molecular Weight | 342.30300 |
| Exact Mass | 342.08500 |
| PSA | 112.66000 |
| LogP | 2.09180 |
| InChIKey | SAYMGIWRNUDWED-UHFFFAOYSA-N |
| SMILES | O=C1c2ccccc2C(=O)N1CC(O)COc1ccc([N+](=O)[O-])cc1 |
|
~%
2-[2-hydroxy-3-... CAS#:94662-07-4 |
| Literature: Petrow; Stephenson Journal of Pharmacy and Pharmacology, 1953 , vol. 5, p. 359,366 |
| N-[2-hydroxy-3-(4-nitro-phenoxy)-propyl]-phthalimide |
| 3-(p-Nitrophenoxy)-1-Phthalimidopropan-2-ol |
| 1H-Isoindole-1,3(2H)-dione,2-[2-hydroxy-3-(4-nitrophenoxy)propyl] |