N-(2-amino-4-methylphenyl)-2-(dimethylamino)acetamide
Modify Date: 2025-09-19 16:21:12
N-(2-amino-4-methylphenyl)-2-(dimethylamino)acetamide structure
|
Common Name | N-(2-amino-4-methylphenyl)-2-(dimethylamino)acetamide | ||
|---|---|---|---|---|
| CAS Number | 946783-06-8 | Molecular Weight | 207.27200 | |
| Density | 1.143g/cm3 | Boiling Point | 379.8ºC at 760 mmHg | |
| Molecular Formula | C11H17N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 183.5ºC | |
| Name | N-(2-amino-4-methylphenyl)-2-(dimethylamino)acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.143g/cm3 |
|---|---|
| Boiling Point | 379.8ºC at 760 mmHg |
| Molecular Formula | C11H17N3O |
| Molecular Weight | 207.27200 |
| Flash Point | 183.5ºC |
| Exact Mass | 207.13700 |
| PSA | 61.85000 |
| LogP | 2.30800 |
| Index of Refraction | 1.606 |
| InChIKey | MVDQBRDJXWYGHK-UHFFFAOYSA-N |
| SMILES | Cc1ccc(NC(=O)CN(C)C)c(N)c1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| n~1~-(2-amino-4-methylphenyl)-n~2~,n~2~-dimethylglycinamide |