6-chloro-2-(chloromethyl)-1H-quinolin-4-one
Modify Date: 2025-11-27 12:22:08
6-chloro-2-(chloromethyl)-1H-quinolin-4-one structure
|
Common Name | 6-chloro-2-(chloromethyl)-1H-quinolin-4-one | ||
|---|---|---|---|---|
| CAS Number | 946784-67-4 | Molecular Weight | 228.07500 | |
| Density | 1.386g/cm3 | Boiling Point | 347.7ºC at 760 mmHg | |
| Molecular Formula | C10H7Cl2NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 164.1ºC | |
| Name | 6-chloro-2-(chloromethyl)-1H-quinolin-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.386g/cm3 |
|---|---|
| Boiling Point | 347.7ºC at 760 mmHg |
| Molecular Formula | C10H7Cl2NO |
| Molecular Weight | 228.07500 |
| Flash Point | 164.1ºC |
| Exact Mass | 226.99000 |
| PSA | 32.86000 |
| LogP | 2.92030 |
| Index of Refraction | 1.595 |
| InChIKey | SDQWGYBBKOOUMC-UHFFFAOYSA-N |
| SMILES | O=c1cc(CCl)[nH]c2ccc(Cl)cc12 |
| HS Code | 2933499090 |
|---|
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6-chloro-2-(chloromethyl)-4(1h)-quinolinone |