4-Chloro-7-isopropoxy-6-methyl-3-quinolinecarbonitrile structure
|
Common Name | 4-Chloro-7-isopropoxy-6-methyl-3-quinolinecarbonitrile | ||
|---|---|---|---|---|
| CAS Number | 947339-95-9 | Molecular Weight | 260.71900 | |
| Density | 1.24g/cm3 | Boiling Point | 406.5ºC at 760 mmHg | |
| Molecular Formula | C14H13ClN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 199.6ºC | |
| Name | 4-Chloro-7-isopropoxy-6-methyl-3-quinolinecarbonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.24g/cm3 |
|---|---|
| Boiling Point | 406.5ºC at 760 mmHg |
| Molecular Formula | C14H13ClN2O |
| Molecular Weight | 260.71900 |
| Flash Point | 199.6ºC |
| Exact Mass | 260.07200 |
| PSA | 45.91000 |
| LogP | 3.85548 |
| Index of Refraction | 1.599 |
| InChIKey | JEKBVFMHZQPBNE-UHFFFAOYSA-N |
| SMILES | Cc1cc2c(Cl)c(C#N)cnc2cc1OC(C)C |
|
~82%
4-Chloro-7-isop... CAS#:947339-95-9 |
| Literature: Cao, Xin; You, Qi-Dong; Li, Zhi-Yu; Guo, Qing-Long; Shang, Jing; Yan, Ming; Chern, Ji-Wang; Chen, Men-Ling Bioorganic and Medicinal Chemistry, 2008 , vol. 16, # 11 p. 5890 - 5898 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| 4-chloro-7-isopropoxy-6-methoxyquinoline-3-carbonitrile |
| 7-isopropyloxy-6-methyl-4-chloroquinoline-3-carbonitrile |
| 7-isopropyloxy-6-methoxy-4-chloroquinoline-3-carbonitrile |