ethyl 2-oxo-2-(2-phenylphenyl)acetate
Modify Date: 2025-09-10 18:01:57
ethyl 2-oxo-2-(2-phenylphenyl)acetate structure
|
Common Name | ethyl 2-oxo-2-(2-phenylphenyl)acetate | ||
|---|---|---|---|---|
| CAS Number | 947701-96-4 | Molecular Weight | 254.28100 | |
| Density | 1.141g/cm3 | Boiling Point | 402.4ºC at 760 mmHg | |
| Molecular Formula | C16H14O3 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 190ºC | |
| Name | ethyl 2-oxo-2-(2-phenylphenyl)acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.141g/cm3 |
|---|---|
| Boiling Point | 402.4ºC at 760 mmHg |
| Molecular Formula | C16H14O3 |
| Molecular Weight | 254.28100 |
| Flash Point | 190ºC |
| Exact Mass | 254.09400 |
| PSA | 43.37000 |
| LogP | 3.09940 |
| Index of Refraction | 1.558 |
| InChIKey | LKGWFUXSKFUHNY-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=O)c1ccccc1-c1ccccc1 |
| HS Code | 2918300090 |
|---|
|
~48%
ethyl 2-oxo-2-(... CAS#:947701-96-4 |
| Literature: Shimizu, Hiroshi; Murakami, Masahiro Chemical Communications, 2007 , # 27 p. 2855 - 2857 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| ethyl 2-(biphenyl-2-yl)-2-oxoacetate |
| ETHYL 2-PHENYLBENZOYLFORMATE |