ethyl (E)-2-cyano-3-(4-fluorophenyl)prop-2-enoate structure
|
Common Name | ethyl (E)-2-cyano-3-(4-fluorophenyl)prop-2-enoate | ||
|---|---|---|---|---|
| CAS Number | 947739-65-3 | Molecular Weight | 219.21 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H10FNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl (E)-2-cyano-3-(4-fluorophenyl)prop-2-enoate |
|---|
| Molecular Formula | C12H10FNO2 |
|---|---|
| Molecular Weight | 219.21 |
| InChIKey | OSTPLWBGNXWIBG-JXMROGBWSA-N |
| SMILES | CCOC(=O)/C(=C/C1=CC=C(C=C1)F)/C#N |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|