3-Methyl-6-phenylimidazo[2,1-b][1,3]thiazol-5-amine
Modify Date: 2026-09-06 11:37:43
![3-Methyl-6-phenylimidazo[2,1-b][1,3]thiazol-5-amine Structure](https://www.chemsrc.com/extcaspic/445/94802-79-6.png)
3-Methyl-6-phenylimidazo[2,1-b][1,3]thiazol-5-amine structure
|
Common Name | 3-Methyl-6-phenylimidazo[2,1-b][1,3]thiazol-5-amine | ||
|---|---|---|---|---|
| CAS Number | 94802-79-6 | Molecular Weight | 229.30 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H11N3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-Methyl-6-phenylimidazo[2,1-b][1,3]thiazol-5-amine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H11N3S |
|---|---|
| Molecular Weight | 229.30 |
| InChIKey | FHQUOFQXOGXNQO-UHFFFAOYSA-N |
| SMILES | Cc1csc2nc(-c3ccccc3)c(N)n12 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 3-Methyl-6-phenylimidazo[2,1-b][1,3]thiazol-5-amine? |
| A: Molecular formula of 3-Methyl-6-phenylimidazo[2,1-b][1,3]thiazol-5-amine is C12H11N3S. |
| Q: What is the SMILES notation of 3-Methyl-6-phenylimidazo[2,1-b][1,3]thiazol-5-amine? |
| A: SMILES notation of 3-Methyl-6-phenylimidazo[2,1-b][1,3]thiazol-5-amine is Cc1csc2nc(-c3ccccc3)c(N)n12. |
| Q: What is the Chinese name of 94802-79-6? |
| A: Chinese name of 94802-79-6 is 94802-79-6. |
| Q: What is the CAS number of 3-Methyl-6-phenylimidazo[2,1-b][1,3]thiazol-5-amine? |
| A: CAS number of 3-Methyl-6-phenylimidazo[2,1-b][1,3]thiazol-5-amine is 94802-79-6. |
| Q: What is the molecular weight of 3-Methyl-6-phenylimidazo[2,1-b][1,3]thiazol-5-amine? |
| A: Molecular weight of 3-Methyl-6-phenylimidazo[2,1-b][1,3]thiazol-5-amine is 229.30. |
| Q: What is the InChIKey of 3-Methyl-6-phenylimidazo[2,1-b][1,3]thiazol-5-amine? |
| A: InChIKey of 3-Methyl-6-phenylimidazo[2,1-b][1,3]thiazol-5-amine is FHQUOFQXOGXNQO-UHFFFAOYSA-N. |
| Q: What is the English name of 3-Methyl-6-phenylimidazo[2,1-b][1,3]thiazol-5-amine? |
| A: The English name of 3-Methyl-6-phenylimidazo[2,1-b][1,3]thiazol-5-amine is 3-Methyl-6-phenylimidazo[2,1-b][1,3]thiazol-5-amine. |