iso-Licoflavonol structure
|
Common Name | iso-Licoflavonol | ||
|---|---|---|---|---|
| CAS Number | 94805-83-1 | Molecular Weight | 354.35 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 601.2±55.0 °C at 760 mmHg | |
| Molecular Formula | C20H18O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 217.4±25.0 °C | |
Use of iso-LicoflavonolIsolicoflavonol potently inhibits hCES2A(Human carboxylesterase 2)-mediated fluorescein diacetate hydrolysis in a reversible and mixed inhibition manner, with Ki values less than 1.0 μM[1]. |
| Name | Isolicoflavonol |
|---|---|
| Synonym | More Synonyms |
| Description | Isolicoflavonol potently inhibits hCES2A(Human carboxylesterase 2)-mediated fluorescein diacetate hydrolysis in a reversible and mixed inhibition manner, with Ki values less than 1.0 μM[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 601.2±55.0 °C at 760 mmHg |
| Molecular Formula | C20H18O6 |
| Molecular Weight | 354.35 |
| Flash Point | 217.4±25.0 °C |
| Exact Mass | 354.110352 |
| PSA | 111.13000 |
| LogP | 4.15 |
| Vapour Pressure | 0.0±1.8 mmHg at 25°C |
| Index of Refraction | 1.700 |
| InChIKey | PGCKDCPTJAQQSQ-UHFFFAOYSA-N |
| SMILES | CC(C)=CCc1cc(-c2oc3cc(O)cc(O)c3c(=O)c2O)ccc1O |
| Storage condition | 2-8C |
| 4H-1-Benzopyran-4-one, 3,5,7-trihydroxy-2-[4-hydroxy-3-(3-methyl-2-buten-1-yl)phenyl]- |
| 3,5,7-Trihydroxy-2-[4-hydroxy-3-(3-methyl-2-buten-1-yl)phenyl]-4H-chromen-4-one |
| iso-Licoflavonol |