5-Allyl-6-methyluracil structure
|
Common Name | 5-Allyl-6-methyluracil | ||
|---|---|---|---|---|
| CAS Number | 94815-68-6 | Molecular Weight | 166.17700 | |
| Density | 1.108g/cm3 | Boiling Point | 401.4ºC at 760 mmHg | |
| Molecular Formula | C8H10N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 196.5ºC | |
| Name | 6-methyl-5-prop-2-enyl-1H-pyrimidine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.108g/cm3 |
|---|---|
| Boiling Point | 401.4ºC at 760 mmHg |
| Molecular Formula | C8H10N2O2 |
| Molecular Weight | 166.17700 |
| Flash Point | 196.5ºC |
| Exact Mass | 166.07400 |
| PSA | 66.24000 |
| LogP | 0.92470 |
| Index of Refraction | 1.49 |
| InChIKey | KWHYPGGBFHXFLD-UHFFFAOYSA-N |
| SMILES | C=CCc1c(C)[nH]c(=O)[nH]c1=O |
| HS Code | 2933599090 |
|---|
|
~%
5-Allyl-6-methy... CAS#:94815-68-6 |
| Literature: Botta, M.; Cavalieri, M.; Ceci, D.; Angelis, F. De; Finizia, G.; Nicoletti, R. Tetrahedron, 1984 , vol. 40, # 17 p. 3313 - 3320 |
|
~%
5-Allyl-6-methy... CAS#:94815-68-6 |
| Literature: Ajello; Miraglia Gazzetta Chimica Italiana, 1948 , vol. 78, p. 921,929 |
|
~%
5-Allyl-6-methy... CAS#:94815-68-6 |
| Literature: Ajello; Miraglia Gazzetta Chimica Italiana, 1948 , vol. 78, p. 921,929 |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-allyl-6-methyl-1H-pyrimidine-2,4-dione |
| 2-hydroxy-6-methyl-5-prop-2-enyl-3-hydropyrimidin-4-one |
| 5-Allyl-6-methyluracil |
| Uracil,5-allyl-6-methyl |
| 5-Allyl-6-methyl-1H-pyrimidin-2,4-dion |
| 5-allil-6-methyluracil |