2,4-ditert-butylspiro[5.5]undeca-1,4,9-trien-3-one
Modify Date: 2025-09-14 17:43:51
![2,4-ditert-butylspiro[5.5]undeca-1,4,9-trien-3-one Structure](https://image.chemsrc.com/caspic/360/94817-72-8.png)
2,4-ditert-butylspiro[5.5]undeca-1,4,9-trien-3-one structure
|
Common Name | 2,4-ditert-butylspiro[5.5]undeca-1,4,9-trien-3-one | ||
|---|---|---|---|---|
| CAS Number | 94817-72-8 | Molecular Weight | 272.42500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H28O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,4-ditert-butylspiro[5.5]undeca-1,4,9-trien-3-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C19H28O |
|---|---|
| Molecular Weight | 272.42500 |
| Exact Mass | 272.21400 |
| PSA | 17.07000 |
| LogP | 5.24060 |
| InChIKey | OJQFZUBBNMIXSO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC2(C=C(C(C)(C)C)C1=O)CC=CCC2 |
|
~99%
2,4-ditert-buty... CAS#:94817-72-8 |
| Literature: Ethyl Corporation Patent: US4562294 A1, 1985 ; |
|
~96%
2,4-ditert-buty... CAS#:94817-72-8 |
| Literature: Ethyl Corporation Patent: US4562294 A1, 1985 ; |
|
~53%
2,4-ditert-buty... CAS#:94817-72-8 |
| Literature: Roper, Jerry M.; Everly, Charles R. Journal of Organic Chemistry, 1988 , vol. 53, # 11 p. 2639 - 2642 |
|
~69%
2,4-ditert-buty... CAS#:94817-72-8 |
| Literature: Baik, Woonphil; Lee, Hyun Joo; Jang, Jung Min; Koo, Sangho; Kim, Byeong Hyo Journal of Organic Chemistry, 2000 , vol. 65, # 1 p. 108 - 115 |
| 2,4-di-tert-butylspiro<5.5>undeca-1,4,7-trien-3-one |
| 2,4-ditert-butylspiro[5.5]undeca-1,4,8-trien-3-one |
| 2,4-di-t-butylspiro[5.5]undeca-1,4,8-trien-3-one |
| Spiro[5.5]undeca-1,4,8-trien-3-one,2,4-bis(1,1-dimethylethyl) |
| 2,4-Di-tert.butylspiro[5,5]undeca-1,4,8-trien-2-on |