(2E,6E)-8-(1,4-DIMETHOXY-3-METHYLNAPHTHALEN-2-YL)-2,6-DIMETHYLOCTA-2,6-DIEN-1-OL structure
|
Common Name | (2E,6E)-8-(1,4-DIMETHOXY-3-METHYLNAPHTHALEN-2-YL)-2,6-DIMETHYLOCTA-2,6-DIEN-1-OL | ||
|---|---|---|---|---|
| CAS Number | 94828-05-4 | Molecular Weight | 354.48300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H30O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 8-(1,4-dimethoxy-3-methylnaphthalen-2-yl)-2,6-dimethylocta-2,6-dien-1-ol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C23H30O3 |
|---|---|
| Molecular Weight | 354.48300 |
| Exact Mass | 354.21900 |
| PSA | 38.69000 |
| LogP | 5.37300 |
| InChIKey | DRXBPDNOLVKFGG-DQKQXWASSA-N |
| SMILES | COc1c(C)c(CC=C(C)CCC=C(C)CO)c(OC)c2ccccc12 |
|
~%
(2E,6E)-8-(1,4-... CAS#:94828-05-4 |
| Literature: Masaki; Hashimoto; Sakuma; Kaji Chemical and Pharmaceutical Bulletin, 1984 , vol. 32, # 10 p. 3952 - 3958 |
|
~%
(2E,6E)-8-(1,4-... CAS#:94828-05-4 |
| Literature: Masaki; Hashimoto; Sakuma; Kaji Chemical and Pharmaceutical Bulletin, 1984 , vol. 32, # 10 p. 3952 - 3958 |
|
~%
(2E,6E)-8-(1,4-... CAS#:94828-05-4 |
| Literature: Masaki; Hashimoto; Sakuma; Kaji Chemical and Pharmaceutical Bulletin, 1984 , vol. 32, # 10 p. 3952 - 3958 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| (2E,6E)-8-(1,4-Dimethoxy-3-methylnaphthalen-2-yl)-2,6-dimethylocta-2,6-dien-1-ol |
| 8-(1,4-dimethoxy-3-methyl-naphtalen-2-yl)-2,6-dimethyl-octa-2,6-dien-1-ol |