ethyl 2,5,7-trimethylquinoline-3-carboxylate structure
|
Common Name | ethyl 2,5,7-trimethylquinoline-3-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 948291-02-9 | Molecular Weight | 243.30100 | |
| Density | 1.105g/cm3 | Boiling Point | 345.5ºC at 760 mmHg | |
| Molecular Formula | C15H17NO2 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 162.8ºC | |
| Name | ethyl 2,5,7-trimethylquinoline-3-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.105g/cm3 |
|---|---|
| Boiling Point | 345.5ºC at 760 mmHg |
| Molecular Formula | C15H17NO2 |
| Molecular Weight | 243.30100 |
| Flash Point | 162.8ºC |
| Exact Mass | 243.12600 |
| PSA | 39.19000 |
| LogP | 3.33670 |
| Index of Refraction | 1.578 |
| InChIKey | LRPXAGBVZQSZPL-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cc2c(C)cc(C)cc2nc1C |
| RIDADR | NONH for all modes of transport |
|---|
| 2,5,7-Trimethylquinoline-3-carboxylic acid ethyl ester |