O-[4-nitro-2-(trifluoromethyl)phenyl]hydroxylamine structure
|
Common Name | O-[4-nitro-2-(trifluoromethyl)phenyl]hydroxylamine | ||
|---|---|---|---|---|
| CAS Number | 94832-15-2 | Molecular Weight | 222.12100 | |
| Density | 1.521±0.06 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C7H5F3N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | O-[4-nitro-2-(trifluoromethyl)phenyl]hydroxylamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.521±0.06 g/cm3 |
|---|---|
| Molecular Formula | C7H5F3N2O3 |
| Molecular Weight | 222.12100 |
| Exact Mass | 222.02500 |
| PSA | 81.07000 |
| LogP | 3.08960 |
| InChIKey | KIEHAOBEQSYFRF-UHFFFAOYSA-N |
| SMILES | NOc1ccc([N+](=O)[O-])cc1C(F)(F)F |
| Water Solubility | Very slightly soluble (0.29 g/L) (25 ºC) |
| HS Code | 2922199090 |
|---|
| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| O-(4-Nitro-2-(trifluoromethyl)phenyl)hydroxylamine |
| Hydroxylamine,O-[4-nitro-2-(trifluoromethyl)phenyl] |