3-chloro-N-(4,6-dimethyl-2-pyridiny)benzamide structure
|
Common Name | 3-chloro-N-(4,6-dimethyl-2-pyridiny)benzamide | ||
|---|---|---|---|---|
| CAS Number | 94843-57-9 | Molecular Weight | 260.71900 | |
| Density | 1.265g/cm3 | Boiling Point | 332.8ºC at 760mmHg | |
| Molecular Formula | C14H13ClN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 155ºC | |
| Name | 3-chloro-N-(4,6-dimethylpyridin-2-yl)benzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.265g/cm3 |
|---|---|
| Boiling Point | 332.8ºC at 760mmHg |
| Molecular Formula | C14H13ClN2O |
| Molecular Weight | 260.71900 |
| Flash Point | 155ºC |
| Exact Mass | 260.07200 |
| PSA | 45.48000 |
| LogP | 3.98810 |
| Index of Refraction | 1.631 |
| InChIKey | XBKSAWQCFGREFJ-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)nc(NC(=O)c2cccc(Cl)c2)c1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| n-pcb |