4,4,4-TRIFLUORO-1-(2,4-DICHLOROPHENYL)-1,3-BUTANEDIONE structure
|
Common Name | 4,4,4-TRIFLUORO-1-(2,4-DICHLOROPHENYL)-1,3-BUTANEDIONE | ||
|---|---|---|---|---|
| CAS Number | 94856-22-1 | Molecular Weight | 285.047 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 301.2±37.0 °C at 760 mmHg | |
| Molecular Formula | C10H5Cl2F3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 135.9±26.5 °C | |
| Name | 1-(2,4-Dichlorophenyl)-4,4,4-trifluorobutane-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 301.2±37.0 °C at 760 mmHg |
| Molecular Formula | C10H5Cl2F3O2 |
| Molecular Weight | 285.047 |
| Flash Point | 135.9±26.5 °C |
| Exact Mass | 283.961884 |
| PSA | 34.14000 |
| LogP | 5.29 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.495 |
| InChIKey | MFGWGSLMYPLKRX-UHFFFAOYSA-N |
| SMILES | O=C(CC(=O)C(F)(F)F)c1ccc(Cl)cc1Cl |
| HS Code | 2914700090 |
|---|
|
~62%
4,4,4-TRIFLUORO... CAS#:94856-22-1 |
| Literature: Fustero, Santos; Roman, Raquel; Sanz-Cervera, Juan F.; Simon-Fuentes, Antonio; Cunat, Ana C.; Villanova, Salvador; Murguia, Marcelo Journal of Organic Chemistry, 2008 , vol. 73, # 9 p. 3523 - 3529 |
|
~66%
4,4,4-TRIFLUORO... CAS#:94856-22-1 |
| Literature: J.B. Chemicals and Pharmaceuticals Limited Patent: US2001/47023 A1, 2001 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 1,3-Butanedione, 1-(2,4-dichlorophenyl)-4,4,4-trifluoro- |
| 1-(2,4-Dichlorophenyl)-4,4,4-trifluoro-1,3-butanedione |
| 1-(2,4-Dichlorophenyl)-4,4,4-trifluorobutane-1,3-dione |