Cyclopenta-2,4-dien-1-yldimethyl(3-phenyl-1H-inden-1-yl)silane
Modify Date: 2026-07-29 18:37:53
Cyclopenta-2,4-dien-1-yldimethyl(3-phenyl-1H-inden-1-yl)silane structure
|
Common Name | Cyclopenta-2,4-dien-1-yldimethyl(3-phenyl-1H-inden-1-yl)silane | ||
|---|---|---|---|---|
| CAS Number | 948573-96-4 | Molecular Weight | 314.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H22Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Cyclopenta-2,4-dien-1-yldimethyl(3-phenyl-1H-inden-1-yl)silane |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C22H22Si |
|---|---|
| Molecular Weight | 314.5 |
| InChIKey | MPPCIRUUNAZIJL-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C1C=CC=C1)C1C=C(c2ccccc2)c2ccccc21 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of Cyclopenta-2,4-dien-1-yldimethyl(3-phenyl-1H-inden-1-yl)silane? |
| A: Molecular weight of Cyclopenta-2,4-dien-1-yldimethyl(3-phenyl-1H-inden-1-yl)silane is 314.5. |
| Q: What is the CAS number of Cyclopenta-2,4-dien-1-yldimethyl(3-phenyl-1H-inden-1-yl)silane? |
| A: CAS number of Cyclopenta-2,4-dien-1-yldimethyl(3-phenyl-1H-inden-1-yl)silane is 948573-96-4. |
| Q: What is the SMILES notation of Cyclopenta-2,4-dien-1-yldimethyl(3-phenyl-1H-inden-1-yl)silane? |
| A: SMILES notation of Cyclopenta-2,4-dien-1-yldimethyl(3-phenyl-1H-inden-1-yl)silane is C[Si](C)(C1C=CC=C1)C1C=C(c2ccccc2)c2ccccc21. |
| Q: What is the InChIKey of Cyclopenta-2,4-dien-1-yldimethyl(3-phenyl-1H-inden-1-yl)silane? |
| A: InChIKey of Cyclopenta-2,4-dien-1-yldimethyl(3-phenyl-1H-inden-1-yl)silane is MPPCIRUUNAZIJL-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 948573-96-4? |
| A: Chinese name of 948573-96-4 is 948573-96-4. |
| Q: What is the molecular formula of Cyclopenta-2,4-dien-1-yldimethyl(3-phenyl-1H-inden-1-yl)silane? |
| A: Molecular formula of Cyclopenta-2,4-dien-1-yldimethyl(3-phenyl-1H-inden-1-yl)silane is C22H22Si. |
| Q: What is the English name of Cyclopenta-2,4-dien-1-yldimethyl(3-phenyl-1H-inden-1-yl)silane? |
| A: The English name of Cyclopenta-2,4-dien-1-yldimethyl(3-phenyl-1H-inden-1-yl)silane is Cyclopenta-2,4-dien-1-yldimethyl(3-phenyl-1H-inden-1-yl)silane. |