Isoasiaticoside
Modify Date: 2025-08-31 12:02:24
Isoasiaticoside structure
|
Common Name | Isoasiaticoside | ||
|---|---|---|---|---|
| CAS Number | 948827-09-6 | Molecular Weight | 959.13 | |
| Density | 1.44±0.1 g/cm3(Predicted) | Boiling Point | 1011.8±65.0 °C(Predicted) | |
| Molecular Formula | C48H78O19 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of IsoasiaticosideIsoasiaticoside is a pentacyclic triterpene saponin that can be isolated from Centella asiatica. Isoasiaticoside has potential neuroprotective effects in the 6-OHDA (HY-B1081)-induced PC12 cell model[1]. |
| Name | Isoasiaticoside |
|---|
| Description | Isoasiaticoside is a pentacyclic triterpene saponin that can be isolated from Centella asiatica. Isoasiaticoside has potential neuroprotective effects in the 6-OHDA (HY-B1081)-induced PC12 cell model[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.44±0.1 g/cm3(Predicted) |
|---|---|
| Boiling Point | 1011.8±65.0 °C(Predicted) |
| Molecular Formula | C48H78O19 |
| Molecular Weight | 959.13 |
| InChIKey | ATNAJMVRCNQHAG-IXBBAURMSA-N |
| SMILES | CC1=CCC2(C(=O)OC3OC(COC4OC(CO)C(OC5OC(C)C(O)C(O)C5O)C(O)C4O)C(O)C(O)C3O)CCC3(C)C(CCC4C5(C)CC(O)C(O)C(C)(CO)C5CCC43C)C2C1C |