3-Imidazo[1,2-a]pyridin-6-yl-3-oxopropanenitrile structure
|
Common Name | 3-Imidazo[1,2-a]pyridin-6-yl-3-oxopropanenitrile | ||
|---|---|---|---|---|
| CAS Number | 948883-29-2 | Molecular Weight | 185.182 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C10H7N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-imidazo[1,2-a]pyridin-6-yl-3-oxopropanenitrile |
|---|
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Molecular Formula | C10H7N3O |
| Molecular Weight | 185.182 |
| Exact Mass | 185.058914 |
| PSA | 58.16000 |
| LogP | 0.15 |
| Index of Refraction | 1.650 |
| InChIKey | MTERNIBSEZLQFD-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC=CN2C=C1C(=O)CC#N |
| HS Code | 2933990090 |
|---|
|
~38%
3-Imidazo[1,2-a... CAS#:948883-29-2 |
| Literature: WYETH; SIENA BIOTECH S.P.A.; HAYDAR, Simon, N.; BOTHMANN, Hendrick; GHIRON, Chiara; MACCARI, Laura; MICCO, Iolanda; NENCINI, Arianna; ZANALETTI, Riccardo Patent: WO2010/9290 A1, 2010 ; Location in patent: Page/Page column 56-57; 60 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |