3,5-dimethoxy-2-(3-methylbut-2-enyl)phenol
3,5-dimethoxy-2-(3-methylbut-2-enyl)phenol structure
|
Common Name | 3,5-dimethoxy-2-(3-methylbut-2-enyl)phenol | ||
|---|---|---|---|---|
| CAS Number | 94935-91-8 | Molecular Weight | 222.28000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H18O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3,5-dimethoxy-2-(3-methylbut-2-enyl)phenol |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H18O3 |
|---|---|
| Molecular Weight | 222.28000 |
| Exact Mass | 222.12600 |
| PSA | 38.69000 |
| LogP | 2.91810 |
| InChIKey | UYNBHZPROJWNLV-UHFFFAOYSA-N |
| SMILES | COc1cc(O)c(CC=C(C)C)c(OC)c1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~30%
3,5-dimethoxy-2... CAS#:94935-91-8 |
| Literature: Nakahira, Hiroyuki; Sunagawa, Makoto Tetrahedron Letters, 1997 , vol. 38, # 25 p. 4443 - 4446 |
|
~%
3,5-dimethoxy-2... CAS#:94935-91-8
Detail
Learn More
|
| Literature: Fukai, Toshio; Fujimoto, Tomoko; Hano, Yoshio; Nomura, Taro; Uzawa, Jun Heterocycles, 1984 , vol. 22, # 12 p. 2805 - 2814 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 3,5-dimethoxy-2-(3-methyl-but-2-enyl)-phenol |
| Phenol,3,5-dimethoxy-2-(3-methyl-2-butenyl) |
| 2-prenyl-3,5-dimethoxyphenol |
| 3,5-dimethoxy-2-prenylphenol |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of 3,5-dimethoxy-2-(3-methylbut-2-enyl)phenol? |
| A: Polar surface area (PSA) of 3,5-dimethoxy-2-(3-methylbut-2-enyl)phenol is 38.69000. |
| Q: What is the Chinese name of 94935-91-8? |
| A: Chinese name of 94935-91-8 is 94935-91-8. |
| Q: What is the English name of 3,5-dimethoxy-2-(3-methylbut-2-enyl)phenol? |
| A: The English name of 3,5-dimethoxy-2-(3-methylbut-2-enyl)phenol is 3,5-dimethoxy-2-(3-methylbut-2-enyl)phenol. |
| Q: What is the molecular formula of 3,5-dimethoxy-2-(3-methylbut-2-enyl)phenol? |
| A: Molecular formula of 3,5-dimethoxy-2-(3-methylbut-2-enyl)phenol is C13H18O3. |
| Q: What is the SMILES notation of 3,5-dimethoxy-2-(3-methylbut-2-enyl)phenol? |
| A: SMILES notation of 3,5-dimethoxy-2-(3-methylbut-2-enyl)phenol is COc1cc(O)c(CC=C(C)C)c(OC)c1. |
| Q: What is the CAS number of 3,5-dimethoxy-2-(3-methylbut-2-enyl)phenol? |
| A: CAS number of 3,5-dimethoxy-2-(3-methylbut-2-enyl)phenol is 94935-91-8. |
| Q: What is the LogP of 3,5-dimethoxy-2-(3-methylbut-2-enyl)phenol? |
| A: LogP of 3,5-dimethoxy-2-(3-methylbut-2-enyl)phenol is 2.91810. |
| Q: What is the InChIKey of 3,5-dimethoxy-2-(3-methylbut-2-enyl)phenol? |
| A: InChIKey of 3,5-dimethoxy-2-(3-methylbut-2-enyl)phenol is UYNBHZPROJWNLV-UHFFFAOYSA-N. |
| Q: What English synonyms does 3,5-dimethoxy-2-(3-methylbut-2-enyl)phenol have? |
| A: English synonyms of 3,5-dimethoxy-2-(3-methylbut-2-enyl)phenol: 3,5-dimethoxy-2-(3-methyl-but-2-enyl)-phenol, Phenol,3,5-dimethoxy-2-(3-methyl-2-butenyl), 2-prenyl-3,5-dimethoxyphenol, 3,5-dimethoxy-2-prenylphenol. |
| Q: What is the molecular weight of 3,5-dimethoxy-2-(3-methylbut-2-enyl)phenol? |
| A: Molecular weight of 3,5-dimethoxy-2-(3-methylbut-2-enyl)phenol is 222.28000. |