1-methyl-1-[6-(1-methylpiperidin-1-ium-1-yl)hexyl]piperidin-1-ium,dibromide
![1-methyl-1-[6-(1-methylpiperidin-1-ium-1-yl)hexyl]piperidin-1-ium,dibromide Structure](https://image.chemsrc.com/caspic/103/94951-04-9.png)
1-methyl-1-[6-(1-methylpiperidin-1-ium-1-yl)hexyl]piperidin-1-ium,dibromide structure
|
Common Name | 1-methyl-1-[6-(1-methylpiperidin-1-ium-1-yl)hexyl]piperidin-1-ium,dibromide | ||
|---|---|---|---|---|
| CAS Number | 94951-04-9 | Molecular Weight | 442.31600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H38Br2N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-methyl-1-[6-(1-methylpiperidin-1-ium-1-yl)hexyl]piperidin-1-ium,dibromide |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C18H38Br2N2 |
|---|---|
| Molecular Weight | 442.31600 |
| Exact Mass | 440.14000 |
| InChIKey | ODSGNIOINIXWMK-UHFFFAOYSA-L |
| SMILES | C[N+]1(CCCCCC[N+]2(C)CCCCC2)CCCCC1.[Br-].[Br-] |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~77%
1-methyl-1-[6-(... CAS#:94951-04-9 |
| Literature: IFP Energies Nouvelles Patent: US2011/190562 A1, 2011 ; Location in patent: Page/Page column 7 ; |
|
~%
1-methyl-1-[6-(... CAS#:94951-04-9 |
| Literature: EXXONMOBIL RESEARCH AND ENGINEERING COMPANY; WESTON, SIMON C.; STROHMAIER, KARL G.; VROMAN, HILDA B. Patent: US2013/115163 A1, 2013 ; Location in patent: Page/Page column ; |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1,1'-Dimethyl-1,1'-hexandiyl-bis-piperidinium,Dibromid |
| Piperidinium,1,1'-(1,6-hexanediyl)bis[1-methyl-,dibromide |
| 1,6-bis(1-methylpiperidin-1-ium)hexane dibromide |
| 1,1'-(hexane-1,6-diyl)bis(1-methylpiperidin-1-ium)bromide |
| 1,1'-dimethyl-1,1'-hexanediyl-bis-piperidinium,dibromide |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 1-methyl-1-[6-(1-methylpiperidin-1-ium-1-yl)hexyl]piperidin-1-ium,dibromide? |
| A: The English name of 1-methyl-1-[6-(1-methylpiperidin-1-ium-1-yl)hexyl]piperidin-1-ium,dibromide is 1-methyl-1-[6-(1-methylpiperidin-1-ium-1-yl)hexyl]piperidin-1-ium,dibromide. |
| Q: What English synonyms does 1-methyl-1-[6-(1-methylpiperidin-1-ium-1-yl)hexyl]piperidin-1-ium,dibromide have? |
| A: English synonyms of 1-methyl-1-[6-(1-methylpiperidin-1-ium-1-yl)hexyl]piperidin-1-ium,dibromide: 1,1'-Dimethyl-1,1'-hexandiyl-bis-piperidinium,Dibromid, Piperidinium,1,1'-(1,6-hexanediyl)bis[1-methyl-,dibromide, 1,6-bis(1-methylpiperidin-1-ium)hexane dibromide, 1,1'-(hexane-1,6-diyl)bis(1-methylpiperidin-1-ium)bromide, 1,1'-dimethyl-1,1'-hexanediyl-bis-piperidinium,dibromide. |
| Q: What is the CAS number of 1-methyl-1-[6-(1-methylpiperidin-1-ium-1-yl)hexyl]piperidin-1-ium,dibromide? |
| A: CAS number of 1-methyl-1-[6-(1-methylpiperidin-1-ium-1-yl)hexyl]piperidin-1-ium,dibromide is 94951-04-9. |
| Q: What is the SMILES notation of 1-methyl-1-[6-(1-methylpiperidin-1-ium-1-yl)hexyl]piperidin-1-ium,dibromide? |
| A: SMILES notation of 1-methyl-1-[6-(1-methylpiperidin-1-ium-1-yl)hexyl]piperidin-1-ium,dibromide is C[N+]1(CCCCCC[N+]2(C)CCCCC2)CCCCC1.[Br-].[Br-]. |
| Q: What is the Chinese name of 94951-04-9? |
| A: Chinese name of 94951-04-9 is 94951-04-9. |
| Q: What is the molecular formula of 1-methyl-1-[6-(1-methylpiperidin-1-ium-1-yl)hexyl]piperidin-1-ium,dibromide? |
| A: Molecular formula of 1-methyl-1-[6-(1-methylpiperidin-1-ium-1-yl)hexyl]piperidin-1-ium,dibromide is C18H38Br2N2. |
| Q: What is the molecular weight of 1-methyl-1-[6-(1-methylpiperidin-1-ium-1-yl)hexyl]piperidin-1-ium,dibromide? |
| A: Molecular weight of 1-methyl-1-[6-(1-methylpiperidin-1-ium-1-yl)hexyl]piperidin-1-ium,dibromide is 442.31600. |
| Q: What is the InChIKey of 1-methyl-1-[6-(1-methylpiperidin-1-ium-1-yl)hexyl]piperidin-1-ium,dibromide? |
| A: InChIKey of 1-methyl-1-[6-(1-methylpiperidin-1-ium-1-yl)hexyl]piperidin-1-ium,dibromide is ODSGNIOINIXWMK-UHFFFAOYSA-L. |