2-oxobutyl(triphenyl)phosphanium,bromide
2-oxobutyl(triphenyl)phosphanium,bromide structure
|
Common Name | 2-oxobutyl(triphenyl)phosphanium,bromide | ||
|---|---|---|---|---|
| CAS Number | 94953-37-4 | Molecular Weight | 413.28700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H22BrOP | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-oxobutyl(triphenyl)phosphanium,bromide |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C22H22BrOP |
|---|---|
| Molecular Weight | 413.28700 |
| Exact Mass | 412.05900 |
| PSA | 30.66000 |
| LogP | 0.96360 |
| InChIKey | XDINDMYCKLKUSU-UHFFFAOYSA-M |
| SMILES | CCC(=O)C[P+](c1ccccc1)(c1ccccc1)c1ccccc1.[Br-] |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~97%
2-oxobutyl(trip... CAS#:94953-37-4 |
| Literature: Manley, David W.; McBurney, Roy T.; Miller, Phillip; Walton, John C.; Mills, Andrew; O'Rourke, Christopher Journal of Organic Chemistry, 2014 , vol. 79, # 3 p. 1386 - 1398 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Phosphonium,(2-oxobutyl)triphenyl-,bromide |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does 2-oxobutyl(triphenyl)phosphanium,bromide have? |
| A: English synonyms of 2-oxobutyl(triphenyl)phosphanium,bromide: Phosphonium,(2-oxobutyl)triphenyl-,bromide. |
| Q: What is the molecular formula of 2-oxobutyl(triphenyl)phosphanium,bromide? |
| A: Molecular formula of 2-oxobutyl(triphenyl)phosphanium,bromide is C22H22BrOP. |
| Q: What is the polar surface area (PSA) of 2-oxobutyl(triphenyl)phosphanium,bromide? |
| A: Polar surface area (PSA) of 2-oxobutyl(triphenyl)phosphanium,bromide is 30.66000. |
| Q: What is the English name of 2-oxobutyl(triphenyl)phosphanium,bromide? |
| A: The English name of 2-oxobutyl(triphenyl)phosphanium,bromide is 2-oxobutyl(triphenyl)phosphanium,bromide. |
| Q: What is the Chinese name of 94953-37-4? |
| A: Chinese name of 94953-37-4 is 94953-37-4. |
| Q: What is the InChIKey of 2-oxobutyl(triphenyl)phosphanium,bromide? |
| A: InChIKey of 2-oxobutyl(triphenyl)phosphanium,bromide is XDINDMYCKLKUSU-UHFFFAOYSA-M. |
| Q: What is the SMILES notation of 2-oxobutyl(triphenyl)phosphanium,bromide? |
| A: SMILES notation of 2-oxobutyl(triphenyl)phosphanium,bromide is CCC(=O)C[P+](c1ccccc1)(c1ccccc1)c1ccccc1.[Br-]. |
| Q: What is the LogP of 2-oxobutyl(triphenyl)phosphanium,bromide? |
| A: LogP of 2-oxobutyl(triphenyl)phosphanium,bromide is 0.96360. |
| Q: What is the CAS number of 2-oxobutyl(triphenyl)phosphanium,bromide? |
| A: CAS number of 2-oxobutyl(triphenyl)phosphanium,bromide is 94953-37-4. |
| Q: What is the molecular weight of 2-oxobutyl(triphenyl)phosphanium,bromide? |
| A: Molecular weight of 2-oxobutyl(triphenyl)phosphanium,bromide is 413.28700. |