acetic acid,2-(tributylstannylmethyl)prop-2-en-1-ol
Modify Date: 2026-07-14 16:46:24
acetic acid,2-(tributylstannylmethyl)prop-2-en-1-ol structure
|
Common Name | acetic acid,2-(tributylstannylmethyl)prop-2-en-1-ol | ||
|---|---|---|---|---|
| CAS Number | 94956-83-9 | Molecular Weight | 421.19400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H38O3Sn | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | acetic acid,2-(tributylstannylmethyl)prop-2-en-1-ol |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C18H38O3Sn |
|---|---|
| Molecular Weight | 421.19400 |
| Exact Mass | 422.18400 |
| PSA | 57.53000 |
| LogP | 4.94090 |
| InChIKey | QIGRNJSDTHGBLD-UHFFFAOYSA-N |
| SMILES | C=C(CO)C[Sn](CCCC)(CCCC)CCCC.CC(=O)O |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2-Propen-1-ol,2-[(tributylstannyl)methyl]-,acetate |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does acetic acid,2-(tributylstannylmethyl)prop-2-en-1-ol have? |
| A: English synonyms of acetic acid,2-(tributylstannylmethyl)prop-2-en-1-ol: 2-Propen-1-ol,2-[(tributylstannyl)methyl]-,acetate. |
| Q: What is the molecular weight of acetic acid,2-(tributylstannylmethyl)prop-2-en-1-ol? |
| A: Molecular weight of acetic acid,2-(tributylstannylmethyl)prop-2-en-1-ol is 421.19400. |
| Q: What is the molecular formula of acetic acid,2-(tributylstannylmethyl)prop-2-en-1-ol? |
| A: Molecular formula of acetic acid,2-(tributylstannylmethyl)prop-2-en-1-ol is C18H38O3Sn. |
| Q: What is the Chinese name of 94956-83-9? |
| A: Chinese name of 94956-83-9 is 94956-83-9. |
| Q: What is the English name of acetic acid,2-(tributylstannylmethyl)prop-2-en-1-ol? |
| A: The English name of acetic acid,2-(tributylstannylmethyl)prop-2-en-1-ol is acetic acid,2-(tributylstannylmethyl)prop-2-en-1-ol. |
| Q: What is the polar surface area (PSA) of acetic acid,2-(tributylstannylmethyl)prop-2-en-1-ol? |
| A: Polar surface area (PSA) of acetic acid,2-(tributylstannylmethyl)prop-2-en-1-ol is 57.53000. |
| Q: What is the CAS number of acetic acid,2-(tributylstannylmethyl)prop-2-en-1-ol? |
| A: CAS number of acetic acid,2-(tributylstannylmethyl)prop-2-en-1-ol is 94956-83-9. |
| Q: What is the InChIKey of acetic acid,2-(tributylstannylmethyl)prop-2-en-1-ol? |
| A: InChIKey of acetic acid,2-(tributylstannylmethyl)prop-2-en-1-ol is QIGRNJSDTHGBLD-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of acetic acid,2-(tributylstannylmethyl)prop-2-en-1-ol? |
| A: SMILES notation of acetic acid,2-(tributylstannylmethyl)prop-2-en-1-ol is C=C(CO)C[Sn](CCCC)(CCCC)CCCC.CC(=O)O. |
| Q: What is the LogP of acetic acid,2-(tributylstannylmethyl)prop-2-en-1-ol? |
| A: LogP of acetic acid,2-(tributylstannylmethyl)prop-2-en-1-ol is 4.94090. |