(S)-glycolic acid, compound with (R)-1,2,3,4,5,6,7,8-octahydro-1-[(4-methoxyphenyl)methyl]isoquinoline (1:1) structure
|
Common Name | (S)-glycolic acid, compound with (R)-1,2,3,4,5,6,7,8-octahydro-1-[(4-methoxyphenyl)methyl]isoquinoline (1:1) | ||
|---|---|---|---|---|
| CAS Number | 94992-57-1 | Molecular Weight | 333.42200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H27NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-hydroxyacetic acid,(1R)-1-[(4-methoxyphenyl)methyl]-1,2,3,4,5,6,7,8-octahydroisoquinoline |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C19H27NO4 |
|---|---|
| Molecular Weight | 333.42200 |
| Exact Mass | 333.19400 |
| PSA | 78.79000 |
| LogP | 2.86230 |
| InChIKey | RIPYWWDTVSFQJZ-UNTBIKODSA-N |
| SMILES | COc1ccc(CC2NCCC3=C2CCCC3)cc1.O=C(O)CO |
| einecs 305-706-5 |