4-bromo-2,6-ditert-butylcyclohexa-2,5-dien-1-one
Modify Date: 2026-07-08 17:13:59
4-bromo-2,6-ditert-butylcyclohexa-2,5-dien-1-one structure
|
Common Name | 4-bromo-2,6-ditert-butylcyclohexa-2,5-dien-1-one | ||
|---|---|---|---|---|
| CAS Number | 950-57-2 | Molecular Weight | 285.22000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H21BrO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-bromo-2,6-ditert-butylcyclohexa-2,5-dien-1-one |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H21BrO |
|---|---|
| Molecular Weight | 285.22000 |
| Exact Mass | 284.07800 |
| PSA | 17.07000 |
| LogP | 4.27760 |
| InChIKey | HUBWEFGDDCBDHF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(Br)C=C(C(C)(C)C)C1=O |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 4-bromo-2,6-di-tert-butylcyclohexa-2,5-dienone |
| 4-Brom-2,6-di-t-butylcyclohexadienon |
| 4-Brom-2,6-di-tert.-butyl-cyclohexadien-(2,5)-on-(1) |
| 4-Brom-2,6-di-tert-butyl-cyclohexa-2,5-dien-1-on |
| 4-Brom-2,6-di-t-butyl-cyclohexa-2,5-dienon |
| 4-Bromo-2,6-di-t-butylcyclohexa-2,5-dien-1-one |
| 2,5-Cyclohexadien-1-one,4-bromo-2,6-bis(1,1-dimethylethyl) |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of 4-bromo-2,6-ditert-butylcyclohexa-2,5-dien-1-one? |
| A: Polar surface area (PSA) of 4-bromo-2,6-ditert-butylcyclohexa-2,5-dien-1-one is 17.07000. |
| Q: What English synonyms does 4-bromo-2,6-ditert-butylcyclohexa-2,5-dien-1-one have? |
| A: English synonyms of 4-bromo-2,6-ditert-butylcyclohexa-2,5-dien-1-one: 4-bromo-2,6-di-tert-butylcyclohexa-2,5-dienone, 4-Brom-2,6-di-t-butylcyclohexadienon, 4-Brom-2,6-di-tert.-butyl-cyclohexadien-(2,5)-on-(1), 4-Brom-2,6-di-tert-butyl-cyclohexa-2,5-dien-1-on, 4-Brom-2,6-di-t-butyl-cyclohexa-2,5-dienon, 4-Bromo-2,6-di-t-butylcyclohexa-2,5-dien-1-one, 2,5-Cyclohexadien-1-one,4-bromo-2,6-bis(1,1-dimethylethyl). |
| Q: What is the InChIKey of 4-bromo-2,6-ditert-butylcyclohexa-2,5-dien-1-one? |
| A: InChIKey of 4-bromo-2,6-ditert-butylcyclohexa-2,5-dien-1-one is HUBWEFGDDCBDHF-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 4-bromo-2,6-ditert-butylcyclohexa-2,5-dien-1-one? |
| A: SMILES notation of 4-bromo-2,6-ditert-butylcyclohexa-2,5-dien-1-one is CC(C)(C)C1=CC(Br)C=C(C(C)(C)C)C1=O. |
| Q: What is the CAS number of 4-bromo-2,6-ditert-butylcyclohexa-2,5-dien-1-one? |
| A: CAS number of 4-bromo-2,6-ditert-butylcyclohexa-2,5-dien-1-one is 950-57-2. |
| Q: What is the LogP of 4-bromo-2,6-ditert-butylcyclohexa-2,5-dien-1-one? |
| A: LogP of 4-bromo-2,6-ditert-butylcyclohexa-2,5-dien-1-one is 4.27760. |
| Q: What is the molecular formula of 4-bromo-2,6-ditert-butylcyclohexa-2,5-dien-1-one? |
| A: Molecular formula of 4-bromo-2,6-ditert-butylcyclohexa-2,5-dien-1-one is C14H21BrO. |
| Q: What is the English name of 4-bromo-2,6-ditert-butylcyclohexa-2,5-dien-1-one? |
| A: The English name of 4-bromo-2,6-ditert-butylcyclohexa-2,5-dien-1-one is 4-bromo-2,6-ditert-butylcyclohexa-2,5-dien-1-one. |
| Q: What is the molecular weight of 4-bromo-2,6-ditert-butylcyclohexa-2,5-dien-1-one? |
| A: Molecular weight of 4-bromo-2,6-ditert-butylcyclohexa-2,5-dien-1-one is 285.22000. |
| Q: What is the Chinese name of 950-57-2? |
| A: Chinese name of 950-57-2 is 950-57-2. |