2-chloro-2'-nitro-biphenyl
2-chloro-2'-nitro-biphenyl structure
|
Common Name | 2-chloro-2'-nitro-biphenyl | ||
|---|---|---|---|---|
| CAS Number | 950-94-7 | Molecular Weight | 233.65000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H8ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-chloro-2'-nitro-biphenyl |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H8ClNO2 |
|---|---|
| Molecular Weight | 233.65000 |
| Exact Mass | 233.02400 |
| PSA | 45.82000 |
| LogP | 4.43840 |
| InChIKey | AASGLKDYFNBDAN-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccccc1-c1ccccc1Cl |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:1203-43-6This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2-Chlor-2'-nitro-biphenyl |
| 2'-chloro-2-nitrobiphenyl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of 2-chloro-2'-nitro-biphenyl? |
| A: Polar surface area (PSA) of 2-chloro-2'-nitro-biphenyl is 45.82000. |
| Q: What is the SMILES notation of 2-chloro-2'-nitro-biphenyl? |
| A: SMILES notation of 2-chloro-2'-nitro-biphenyl is O=[N+]([O-])c1ccccc1-c1ccccc1Cl. |
| Q: What is the CAS number of 2-chloro-2'-nitro-biphenyl? |
| A: CAS number of 2-chloro-2'-nitro-biphenyl is 950-94-7. |
| Q: What is the InChIKey of 2-chloro-2'-nitro-biphenyl? |
| A: InChIKey of 2-chloro-2'-nitro-biphenyl is AASGLKDYFNBDAN-UHFFFAOYSA-N. |
| Q: What are the downstream products of 2-chloro-2'-nitro-biphenyl? |
| A: Related downstream products(CAS) of 2-chloro-2'-nitro-biphenyl: 1203-43-6. |
| Q: What is the molecular weight of 2-chloro-2'-nitro-biphenyl? |
| A: Molecular weight of 2-chloro-2'-nitro-biphenyl is 233.65000. |
| Q: What is the molecular formula of 2-chloro-2'-nitro-biphenyl? |
| A: Molecular formula of 2-chloro-2'-nitro-biphenyl is C12H8ClNO2. |
| Q: What is the LogP of 2-chloro-2'-nitro-biphenyl? |
| A: LogP of 2-chloro-2'-nitro-biphenyl is 4.43840. |
| Q: What is the English name of 2-chloro-2'-nitro-biphenyl? |
| A: The English name of 2-chloro-2'-nitro-biphenyl is 2-chloro-2'-nitro-biphenyl. |
| Q: What English synonyms does 2-chloro-2'-nitro-biphenyl have? |
| A: English synonyms of 2-chloro-2'-nitro-biphenyl: 2-Chlor-2'-nitro-biphenyl, 2'-chloro-2-nitrobiphenyl. |