2-(4-Allyl-2-methoxyphenoxy)-N-(3-(diethylamino)propyl)-2-methyl-propi onamide structure
|
Common Name | 2-(4-Allyl-2-methoxyphenoxy)-N-(3-(diethylamino)propyl)-2-methyl-propi onamide | ||
|---|---|---|---|---|
| CAS Number | 95001-13-1 | Molecular Weight | 362.50600 | |
| Density | 1.006g/cm3 | Boiling Point | 510.2ºC at 760mmHg | |
| Molecular Formula | C21H34N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-[3-(diethylamino)propyl]-2-(2-methoxy-4-prop-2-enylphenoxy)-2-methylpropanamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.006g/cm3 |
|---|---|
| Boiling Point | 510.2ºC at 760mmHg |
| Molecular Formula | C21H34N2O3 |
| Molecular Weight | 362.50600 |
| Exact Mass | 362.25700 |
| PSA | 54.29000 |
| LogP | 4.26950 |
| Index of Refraction | 1.506 |
| InChIKey | IVDZJIMVSWUCIM-UHFFFAOYSA-N |
| SMILES | C=CCc1ccc(OC(C)(C)C(=O)NCCCN(CC)CC)c(OC)c1 |
| HS Code | 2924299090 |
|---|
|
~%
2-(4-Allyl-2-me... CAS#:95001-13-1 |
| Literature: Buttini,A. et al. Bollettino Chimico Farmaceutico, 1962 , vol. 101, p. 619 - 623 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Propionamide,2-(4-allyl-2-methoxyphenoxy)-N-(3-(diethylamino)propyl)-2-methyl |
| 2-[N-(3-Diethylamino-propyl)-carbamoyl]-2-(2-methoxy-4-allyl-phenoxy)-propan |
| Sch 1503 |
| 2-(4-Allyl-2-methoxyphenoxy)-N-(3-(diethylamino)propyl)-2-methyl-propionamide |