2-[(E)-but-1-enyl]-5-butyl-2,3,4-tripropylpyrrole
Modify Date: 2026-08-11 11:55:14
![2-[(E)-but-1-enyl]-5-butyl-2,3,4-tripropylpyrrole Structure](https://www.chemsrc.com/extcaspic/218/950179-06-3.png)
2-[(E)-but-1-enyl]-5-butyl-2,3,4-tripropylpyrrole structure
|
Common Name | 2-[(E)-but-1-enyl]-5-butyl-2,3,4-tripropylpyrrole | ||
|---|---|---|---|---|
| CAS Number | 950179-06-3 | Molecular Weight | 303.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H37N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-[(E)-but-1-enyl]-5-butyl-2,3,4-tripropylpyrrole |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C21H37N |
|---|---|
| Molecular Weight | 303.5 |
| InChIKey | ATMXFLLVTBOMSU-SFQUDFHCSA-N |
| SMILES | CCC=CC1(CCC)N=C(CCCC)C(CCC)=C1CCC |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 2-[(E)-but-1-enyl]-5-butyl-2,3,4-tripropylpyrrole? |
| A: The English name of 2-[(E)-but-1-enyl]-5-butyl-2,3,4-tripropylpyrrole is 2-[(E)-but-1-enyl]-5-butyl-2,3,4-tripropylpyrrole. |
| Q: What is the CAS number of 2-[(E)-but-1-enyl]-5-butyl-2,3,4-tripropylpyrrole? |
| A: CAS number of 2-[(E)-but-1-enyl]-5-butyl-2,3,4-tripropylpyrrole is 950179-06-3. |
| Q: What is the molecular formula of 2-[(E)-but-1-enyl]-5-butyl-2,3,4-tripropylpyrrole? |
| A: Molecular formula of 2-[(E)-but-1-enyl]-5-butyl-2,3,4-tripropylpyrrole is C21H37N. |
| Q: What is the InChIKey of 2-[(E)-but-1-enyl]-5-butyl-2,3,4-tripropylpyrrole? |
| A: InChIKey of 2-[(E)-but-1-enyl]-5-butyl-2,3,4-tripropylpyrrole is ATMXFLLVTBOMSU-SFQUDFHCSA-N. |
| Q: What is the Chinese name of 950179-06-3? |
| A: Chinese name of 950179-06-3 is 950179-06-3. |
| Q: What is the molecular weight of 2-[(E)-but-1-enyl]-5-butyl-2,3,4-tripropylpyrrole? |
| A: Molecular weight of 2-[(E)-but-1-enyl]-5-butyl-2,3,4-tripropylpyrrole is 303.5. |
| Q: What is the SMILES notation of 2-[(E)-but-1-enyl]-5-butyl-2,3,4-tripropylpyrrole? |
| A: SMILES notation of 2-[(E)-but-1-enyl]-5-butyl-2,3,4-tripropylpyrrole is CCC=CC1(CCC)N=C(CCCC)C(CCC)=C1CCC. |