[(3,4-Dichloro-2-methoxyphenyl)sulfonyl](2-hydroxypropyl)amine
Modify Date: 2026-07-06 17:51:52
amine Structure](https://www.chemsrc.com/extcaspic/038/950239-67-5.png)
[(3,4-Dichloro-2-methoxyphenyl)sulfonyl](2-hydroxypropyl)amine structure
|
Common Name | [(3,4-Dichloro-2-methoxyphenyl)sulfonyl](2-hydroxypropyl)amine | ||
|---|---|---|---|---|
| CAS Number | 950239-67-5 | Molecular Weight | 314.18 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H13Cl2NO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | [(3,4-Dichloro-2-methoxyphenyl)sulfonyl](2-hydroxypropyl)amine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H13Cl2NO4S |
|---|---|
| Molecular Weight | 314.18 |
| InChIKey | OTBQKQZBEYLMNM-UHFFFAOYSA-N |
| SMILES | COc1c(S(=O)(=O)NCC(C)O)ccc(Cl)c1Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of [(3,4-Dichloro-2-methoxyphenyl)sulfonyl](2-hydroxypropyl)amine? |
| A: The English name of [(3,4-Dichloro-2-methoxyphenyl)sulfonyl](2-hydroxypropyl)amine is [(3,4-Dichloro-2-methoxyphenyl)sulfonyl](2-hydroxypropyl)amine. |
| Q: What is the Chinese name of 950239-67-5? |
| A: Chinese name of 950239-67-5 is 950239-67-5. |
| Q: What is the molecular formula of [(3,4-Dichloro-2-methoxyphenyl)sulfonyl](2-hydroxypropyl)amine? |
| A: Molecular formula of [(3,4-Dichloro-2-methoxyphenyl)sulfonyl](2-hydroxypropyl)amine is C10H13Cl2NO4S. |
| Q: What is the SMILES notation of [(3,4-Dichloro-2-methoxyphenyl)sulfonyl](2-hydroxypropyl)amine? |
| A: SMILES notation of [(3,4-Dichloro-2-methoxyphenyl)sulfonyl](2-hydroxypropyl)amine is COc1c(S(=O)(=O)NCC(C)O)ccc(Cl)c1Cl. |
| Q: What is the molecular weight of [(3,4-Dichloro-2-methoxyphenyl)sulfonyl](2-hydroxypropyl)amine? |
| A: Molecular weight of [(3,4-Dichloro-2-methoxyphenyl)sulfonyl](2-hydroxypropyl)amine is 314.18. |
| Q: What is the InChIKey of [(3,4-Dichloro-2-methoxyphenyl)sulfonyl](2-hydroxypropyl)amine? |
| A: InChIKey of [(3,4-Dichloro-2-methoxyphenyl)sulfonyl](2-hydroxypropyl)amine is OTBQKQZBEYLMNM-UHFFFAOYSA-N. |
| Q: What is the CAS number of [(3,4-Dichloro-2-methoxyphenyl)sulfonyl](2-hydroxypropyl)amine? |
| A: CAS number of [(3,4-Dichloro-2-methoxyphenyl)sulfonyl](2-hydroxypropyl)amine is 950239-67-5. |