1-(3,4-dichlorophenyl)-N,N-dimethylmethanesulfonamide
Modify Date: 2026-07-17 21:54:03
1-(3,4-dichlorophenyl)-N,N-dimethylmethanesulfonamide structure
|
Common Name | 1-(3,4-dichlorophenyl)-N,N-dimethylmethanesulfonamide | ||
|---|---|---|---|---|
| CAS Number | 950255-76-2 | Molecular Weight | 268.16 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H11Cl2NO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-(3,4-dichlorophenyl)-N,N-dimethylmethanesulfonamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H11Cl2NO2S |
|---|---|
| Molecular Weight | 268.16 |
| InChIKey | RETQUDVMLDESJA-UHFFFAOYSA-N |
| SMILES | CN(C)S(=O)(=O)Cc1ccc(Cl)c(Cl)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 1-(3,4-dichlorophenyl)-N,N-dimethylmethanesulfonamide? |
| A: Molecular weight of 1-(3,4-dichlorophenyl)-N,N-dimethylmethanesulfonamide is 268.16. |
| Q: What is the Chinese name of 950255-76-2? |
| A: Chinese name of 950255-76-2 is 950255-76-2. |
| Q: What is the molecular formula of 1-(3,4-dichlorophenyl)-N,N-dimethylmethanesulfonamide? |
| A: Molecular formula of 1-(3,4-dichlorophenyl)-N,N-dimethylmethanesulfonamide is C9H11Cl2NO2S. |
| Q: What is the English name of 1-(3,4-dichlorophenyl)-N,N-dimethylmethanesulfonamide? |
| A: The English name of 1-(3,4-dichlorophenyl)-N,N-dimethylmethanesulfonamide is 1-(3,4-dichlorophenyl)-N,N-dimethylmethanesulfonamide. |
| Q: What is the CAS number of 1-(3,4-dichlorophenyl)-N,N-dimethylmethanesulfonamide? |
| A: CAS number of 1-(3,4-dichlorophenyl)-N,N-dimethylmethanesulfonamide is 950255-76-2. |
| Q: What is the SMILES notation of 1-(3,4-dichlorophenyl)-N,N-dimethylmethanesulfonamide? |
| A: SMILES notation of 1-(3,4-dichlorophenyl)-N,N-dimethylmethanesulfonamide is CN(C)S(=O)(=O)Cc1ccc(Cl)c(Cl)c1. |
| Q: What is the InChIKey of 1-(3,4-dichlorophenyl)-N,N-dimethylmethanesulfonamide? |
| A: InChIKey of 1-(3,4-dichlorophenyl)-N,N-dimethylmethanesulfonamide is RETQUDVMLDESJA-UHFFFAOYSA-N. |