3-(3-methylphenyl)-1-sulfanylidene-5a,6,7,8,9,9a-hexahydro-4H-[1,3]thiazolo[3,4-a]quinazolin-5-one structure
|
Common Name | 3-(3-methylphenyl)-1-sulfanylidene-5a,6,7,8,9,9a-hexahydro-4H-[1,3]thiazolo[3,4-a]quinazolin-5-one | ||
|---|---|---|---|---|
| CAS Number | 950270-50-5 | Molecular Weight | 330.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H18N2OS2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-(3-methylphenyl)-1-sulfanylidene-5a,6,7,8,9,9a-hexahydro-4H-[1,3]thiazolo[3,4-a]quinazolin-5-one |
|---|
| Molecular Formula | C17H18N2OS2 |
|---|---|
| Molecular Weight | 330.5 |
| InChIKey | SJNKFAHXBXZPDE-UHFFFAOYSA-N |
| SMILES | Cc1cccc(-c2sc(=S)n3c2NC(=O)C2CCCCC23)c1 |
|
Name: Inhibitors of CDC25B-CDK2/CyclinA interaction
Source: Center for Chemical Genomics, University of Michigan
External Id: MScreen:TargetID_600
|