dl-2,2'-Bis(p-fluorophenyl)(3,3'-bithiazolidine)-4,4'-dione
Modify Date: 2026-08-04 10:50:51
dl-2,2'-Bis(p-fluorophenyl)(3,3'-bithiazolidine)-4,4'-dione structure
|
Common Name | dl-2,2'-Bis(p-fluorophenyl)(3,3'-bithiazolidine)-4,4'-dione | ||
|---|---|---|---|---|
| CAS Number | 95035-82-8 | Molecular Weight | 392.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H14F2N2O2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | dl-2,2'-Bis(p-fluorophenyl)(3,3'-bithiazolidine)-4,4'-dione |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C18H14F2N2O2S2 |
|---|---|
| Molecular Weight | 392.4 |
| InChIKey | OSSKXWAHAQAUEH-UHFFFAOYSA-N |
| SMILES | O=C1CSC(c2ccc(F)cc2)N1N1C(=O)CSC1c1ccc(F)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of dl-2,2'-Bis(p-fluorophenyl)(3,3'-bithiazolidine)-4,4'-dione? |
| A: SMILES notation of dl-2,2'-Bis(p-fluorophenyl)(3,3'-bithiazolidine)-4,4'-dione is O=C1CSC(c2ccc(F)cc2)N1N1C(=O)CSC1c1ccc(F)cc1. |
| Q: What is the English name of dl-2,2'-Bis(p-fluorophenyl)(3,3'-bithiazolidine)-4,4'-dione? |
| A: The English name of dl-2,2'-Bis(p-fluorophenyl)(3,3'-bithiazolidine)-4,4'-dione is dl-2,2'-Bis(p-fluorophenyl)(3,3'-bithiazolidine)-4,4'-dione. |
| Q: What is the molecular formula of dl-2,2'-Bis(p-fluorophenyl)(3,3'-bithiazolidine)-4,4'-dione? |
| A: Molecular formula of dl-2,2'-Bis(p-fluorophenyl)(3,3'-bithiazolidine)-4,4'-dione is C18H14F2N2O2S2. |
| Q: What is the InChIKey of dl-2,2'-Bis(p-fluorophenyl)(3,3'-bithiazolidine)-4,4'-dione? |
| A: InChIKey of dl-2,2'-Bis(p-fluorophenyl)(3,3'-bithiazolidine)-4,4'-dione is OSSKXWAHAQAUEH-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 95035-82-8? |
| A: Chinese name of 95035-82-8 is 95035-82-8. |
| Q: What is the molecular weight of dl-2,2'-Bis(p-fluorophenyl)(3,3'-bithiazolidine)-4,4'-dione? |
| A: Molecular weight of dl-2,2'-Bis(p-fluorophenyl)(3,3'-bithiazolidine)-4,4'-dione is 392.4. |
| Q: What is the CAS number of dl-2,2'-Bis(p-fluorophenyl)(3,3'-bithiazolidine)-4,4'-dione? |
| A: CAS number of dl-2,2'-Bis(p-fluorophenyl)(3,3'-bithiazolidine)-4,4'-dione is 95035-82-8. |