1-(3-(4-chlorophenyl)benzo[c]isoxazol-5-yl)-N-(furan-2-ylmethyl)-5-methyl-1H-1,2,3-triazole-4-carboxamide structure
|
Common Name | 1-(3-(4-chlorophenyl)benzo[c]isoxazol-5-yl)-N-(furan-2-ylmethyl)-5-methyl-1H-1,2,3-triazole-4-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 950357-49-0 | Molecular Weight | 433.8 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H16ClN5O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-(3-(4-chlorophenyl)benzo[c]isoxazol-5-yl)-N-(furan-2-ylmethyl)-5-methyl-1H-1,2,3-triazole-4-carboxamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C22H16ClN5O3 |
|---|---|
| Molecular Weight | 433.8 |
| InChIKey | DNYPTQPEQQAMPZ-UHFFFAOYSA-N |
| SMILES | Cc1c(C(=O)NCc2ccco2)nnn1-c1ccc2noc(-c3ccc(Cl)cc3)c2c1 |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Cytotoxicity against human MDA-MB-468 cells assessed as cell growth at 10'-5 M after ...
Source: ChEMBL
Target: MDA-MB-468
External Id: CHEMBL2427971
|
|
Name: Cytotoxicity against human UO31 cells assessed as cell growth at 10'-5 M after 48 hrs...
Source: ChEMBL
Target: UO-31
External Id: CHEMBL2427990
|
|
Name: Cytotoxicity against human A498 cells assessed as cell growth at 10'-5 M after 48 hrs...
Source: ChEMBL
Target: A498
External Id: CHEMBL2427993
|
|
Name: Cytotoxicity against human RPMI8226 cells assessed as cell growth at 10'-5 M after 48...
Source: ChEMBL
Target: RPMI-8226
External Id: CHEMBL2429110
|
|
Name: Discovering small molecule activators of G protein-gated inwardly-rectifying potassiu...
Source: 15621
Target: G protein-activated inward rectifier potassium channel 2
External Id: VANDERBILT_HTS_GIRK2_MPD
|
|
Name: Cytotoxicity against human UACC62 cells assessed as cell growth at 10'-5 M after 48 h...
Source: ChEMBL
Target: UACC-62
External Id: CHEMBL2427997
|
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 1-(3-(4-chlorophenyl)benzo[c]isoxazol-5-yl)-N-(furan-2-ylmethyl)-5-methyl-1H-1,2,3-triazole-4-carboxamide? |
| A: The English name of 1-(3-(4-chlorophenyl)benzo[c]isoxazol-5-yl)-N-(furan-2-ylmethyl)-5-methyl-1H-1,2,3-triazole-4-carboxamide is 1-(3-(4-chlorophenyl)benzo[c]isoxazol-5-yl)-N-(furan-2-ylmethyl)-5-methyl-1H-1,2,3-triazole-4-carboxamide. |
| Q: What is the InChIKey of 1-(3-(4-chlorophenyl)benzo[c]isoxazol-5-yl)-N-(furan-2-ylmethyl)-5-methyl-1H-1,2,3-triazole-4-carboxamide? |
| A: InChIKey of 1-(3-(4-chlorophenyl)benzo[c]isoxazol-5-yl)-N-(furan-2-ylmethyl)-5-methyl-1H-1,2,3-triazole-4-carboxamide is DNYPTQPEQQAMPZ-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 1-(3-(4-chlorophenyl)benzo[c]isoxazol-5-yl)-N-(furan-2-ylmethyl)-5-methyl-1H-1,2,3-triazole-4-carboxamide? |
| A: Molecular formula of 1-(3-(4-chlorophenyl)benzo[c]isoxazol-5-yl)-N-(furan-2-ylmethyl)-5-methyl-1H-1,2,3-triazole-4-carboxamide is C22H16ClN5O3. |
| Q: What is the CAS number of 1-(3-(4-chlorophenyl)benzo[c]isoxazol-5-yl)-N-(furan-2-ylmethyl)-5-methyl-1H-1,2,3-triazole-4-carboxamide? |
| A: CAS number of 1-(3-(4-chlorophenyl)benzo[c]isoxazol-5-yl)-N-(furan-2-ylmethyl)-5-methyl-1H-1,2,3-triazole-4-carboxamide is 950357-49-0. |
| Q: What is the Chinese name of 950357-49-0? |
| A: Chinese name of 950357-49-0 is 950357-49-0. |
| Q: What is the molecular weight of 1-(3-(4-chlorophenyl)benzo[c]isoxazol-5-yl)-N-(furan-2-ylmethyl)-5-methyl-1H-1,2,3-triazole-4-carboxamide? |
| A: Molecular weight of 1-(3-(4-chlorophenyl)benzo[c]isoxazol-5-yl)-N-(furan-2-ylmethyl)-5-methyl-1H-1,2,3-triazole-4-carboxamide is 433.8. |
| Q: What is the SMILES notation of 1-(3-(4-chlorophenyl)benzo[c]isoxazol-5-yl)-N-(furan-2-ylmethyl)-5-methyl-1H-1,2,3-triazole-4-carboxamide? |
| A: SMILES notation of 1-(3-(4-chlorophenyl)benzo[c]isoxazol-5-yl)-N-(furan-2-ylmethyl)-5-methyl-1H-1,2,3-triazole-4-carboxamide is Cc1c(C(=O)NCc2ccco2)nnn1-c1ccc2noc(-c3ccc(Cl)cc3)c2c1. |