N-(2-fluorophenyl)-1-oxo-1H-isothiochromene-3-carboxamide structure
|
Common Name | N-(2-fluorophenyl)-1-oxo-1H-isothiochromene-3-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 950383-09-2 | Molecular Weight | 299.3 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H10FNO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(2-fluorophenyl)-1-oxo-1H-isothiochromene-3-carboxamide |
|---|
| Molecular Formula | C16H10FNO2S |
|---|---|
| Molecular Weight | 299.3 |
| InChIKey | ILJXHMZIQXKGDV-UHFFFAOYSA-N |
| SMILES | O=C(Nc1ccccc1F)c1cc2ccccc2c(=O)s1 |
|
Name: Inhibitors of CDC25B-CDK2/CyclinA interaction
Source: Center for Chemical Genomics, University of Michigan
External Id: MScreen:TargetID_600
|