1-methoxycarbonyl-5,6,8,10-tetramethylheptalene-2-carboxylate
1-methoxycarbonyl-5,6,8,10-tetramethylheptalene-2-carboxylate structure
|
Common Name | 1-methoxycarbonyl-5,6,8,10-tetramethylheptalene-2-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 95045-21-9 | Molecular Weight | 311.35200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H19O4- | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-methoxycarbonyl-5,6,8,10-tetramethylheptalene-2-carboxylate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C19H19O4- |
|---|---|
| Molecular Weight | 311.35200 |
| Exact Mass | 311.12800 |
| PSA | 66.43000 |
| LogP | 2.31490 |
| InChIKey | UJNWDQXSFSLVGK-UHFFFAOYSA-M |
| SMILES | COC(=O)C1=C2C(C)=CC(C)=CC(C)=C2C(C)=CC=C1C(=O)[O-] |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
1-methoxycarbon... CAS#:95045-21-9 |
| Literature: Bernhard, Werner; Bruegger, Paul; Daly, John J.; Schoenholzer, Peter; Weber, Roland H.; Hansen, Hans-Juergen Helvetica Chimica Acta, 1985 , vol. 68, p. 415 - 428 |
|
~%
1-methoxycarbon... CAS#:95045-21-9 |
| Literature: Weber, Roland H.; Bruegger, Paul; Arnold, Wolf; Schoenholzer, Peter; Hansen, Hans-Juergen Helvetica Chimica Acta, 1987 , vol. 70, p. 1439 - 1460 |
|
~%
1-methoxycarbon... CAS#:95045-21-9 |
| Literature: Weber, Roland H.; Bruegger, Paul; Arnold, Wolf; Schoenholzer, Peter; Hansen, Hans-Juergen Helvetica Chimica Acta, 1987 , vol. 70, p. 1439 - 1460 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 5-methoxycarbonyl-1,6,8,10-tetramethylheptalene-4-carboxylic acid |
| 5-methyl 4-hydrogen 1,6,8,10-tetramethylheptalene-4,5-dicarboxylate |
| 1,2-Heptalenedicarboxylic acid,5,6,8,10-tetramethyl-,1-methyl ester |
| (-)-(P)-1-methoxycarbonyl-5,6,8,10-tetramethylheptalene-2-carboxylic acid |
| rac-1-methoxycarbonyl-5,6,8,10-tetramethylheptalene-2-carboxylic acid |
| (+)-(M)-1-methoxycarbonyl-5,6,8,10-tetramethylheptalene-2-carboxylic acid |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 1-methoxycarbonyl-5,6,8,10-tetramethylheptalene-2-carboxylate? |
| A: Molecular weight of 1-methoxycarbonyl-5,6,8,10-tetramethylheptalene-2-carboxylate is 311.35200. |
| Q: What is the CAS number of 1-methoxycarbonyl-5,6,8,10-tetramethylheptalene-2-carboxylate? |
| A: CAS number of 1-methoxycarbonyl-5,6,8,10-tetramethylheptalene-2-carboxylate is 95045-21-9. |
| Q: What is the LogP of 1-methoxycarbonyl-5,6,8,10-tetramethylheptalene-2-carboxylate? |
| A: LogP of 1-methoxycarbonyl-5,6,8,10-tetramethylheptalene-2-carboxylate is 2.31490. |
| Q: What is the InChIKey of 1-methoxycarbonyl-5,6,8,10-tetramethylheptalene-2-carboxylate? |
| A: InChIKey of 1-methoxycarbonyl-5,6,8,10-tetramethylheptalene-2-carboxylate is UJNWDQXSFSLVGK-UHFFFAOYSA-M. |
| Q: What is the SMILES notation of 1-methoxycarbonyl-5,6,8,10-tetramethylheptalene-2-carboxylate? |
| A: SMILES notation of 1-methoxycarbonyl-5,6,8,10-tetramethylheptalene-2-carboxylate is COC(=O)C1=C2C(C)=CC(C)=CC(C)=C2C(C)=CC=C1C(=O)[O-]. |
| Q: What is the molecular formula of 1-methoxycarbonyl-5,6,8,10-tetramethylheptalene-2-carboxylate? |
| A: Molecular formula of 1-methoxycarbonyl-5,6,8,10-tetramethylheptalene-2-carboxylate is C19H19O4-. |
| Q: What is the polar surface area (PSA) of 1-methoxycarbonyl-5,6,8,10-tetramethylheptalene-2-carboxylate? |
| A: Polar surface area (PSA) of 1-methoxycarbonyl-5,6,8,10-tetramethylheptalene-2-carboxylate is 66.43000. |
| Q: What is the English name of 1-methoxycarbonyl-5,6,8,10-tetramethylheptalene-2-carboxylate? |
| A: The English name of 1-methoxycarbonyl-5,6,8,10-tetramethylheptalene-2-carboxylate is 1-methoxycarbonyl-5,6,8,10-tetramethylheptalene-2-carboxylate. |
| Q: What is the Chinese name of 95045-21-9? |
| A: Chinese name of 95045-21-9 is 95045-21-9. |